The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-Methyl-1-((5-oxomorpholin-2-yl)methyl)-5-((4-((6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl)amino)piperidin-1-yl)-methyl)-1H-indole-2-carbonitrile ID: ALA4216801
PubChem CID: 130376005
Max Phase: Preclinical
Molecular Formula: C29H30F3N7O2S
Molecular Weight: 597.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(CN2CCC(Nc3ncnc4sc(CC(F)(F)F)cc34)CC2)ccc2c1cc(C#N)n2C[C@@H]1CNC(=O)CO1
Standard InChI: InChI=1S/C29H30F3N7O2S/c1-17-18(2-3-25-23(17)8-20(11-33)39(25)14-21-12-34-26(40)15-41-21)13-38-6-4-19(5-7-38)37-27-24-9-22(10-29(30,31)32)42-28(24)36-16-35-27/h2-3,8-9,16,19,21H,4-7,10,12-15H2,1H3,(H,34,40)(H,35,36,37)/t21-/m0/s1
Standard InChI Key: JTUOGOXWKQAKOR-NRFANRHFSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
1.3152 -21.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3140 -22.0004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0262 -22.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0244 -20.7638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7330 -21.1732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7337 -21.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5261 -22.2444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0076 -21.5751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5184 -20.9116 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.8289 -21.5703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2333 -20.8561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0546 -20.8512 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8206 -20.1466 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.6378 -20.1409 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.0273 -23.2307 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7355 -23.6425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7351 -24.4629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4434 -24.8705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1572 -24.4644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1581 -23.6422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4452 -23.2259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8680 -24.8748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5808 -24.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2851 -24.8810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2842 -23.2384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5789 -23.6510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2812 -25.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0000 -23.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9979 -24.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7775 -24.7270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2630 -24.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7808 -23.3984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0840 -24.0613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9053 -24.0633 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7757 -22.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4850 -22.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1936 -22.5705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9008 -22.1610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8999 -21.3394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1857 -20.9289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4724 -21.3442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6108 -20.9249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
11 13 1 0
11 14 1 0
3 15 1 0
15 16 1 0
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
19 22 1 0
22 23 1 0
23 24 2 0
24 29 1 0
28 25 1 0
25 26 2 0
26 23 1 0
24 27 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 28 1 0
33 34 3 0
31 33 1 0
32 35 1 0
36 35 1 1
36 37 1 0
36 41 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
39 42 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 597.67Molecular Weight (Monoisotopic): 597.2134AlogP: 4.52#Rotatable Bonds: 7Polar Surface Area: 108.10Molecular Species: BASEHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.74CX Basic pKa: 8.76CX LogP: 3.74CX LogD: 2.36Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.32Np Likeness Score: -1.37
References 1. Borkin D, Klossowski S, Pollock J, Miao H, Linhares BM, Kempinska K, Jin Z, Purohit T, Wen B, He M, Sun D, Cierpicki T, Grembecka J.. (2018) Complexity of Blocking Bivalent Protein-Protein Interactions: Development of a Highly Potent Inhibitor of the Menin-Mixed-Lineage Leukemia Interaction., 61 (11): [PMID:29738674 ] [10.1021/acs.jmedchem.8b00071 ] 2. Aguilar A, Zheng K, Xu T, Xu S, Huang L, Fernandez-Salas E, Liu L, Bernard D, Harvey KP, Foster C, McEachern D, Stuckey J, Chinnaswamy K, Delproposto J, Kampf JW, Wang S.. (2019) Structure-Based Discovery of M-89 as a Highly Potent Inhibitor of the Menin-Mixed Lineage Leukemia (Menin-MLL) Protein-Protein Interaction., 62 (13): [PMID:31244110 ] [10.1021/acs.jmedchem.9b00021 ]