The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-((S)-2-acetamido-4-methylpentanoyl)-N-((S)-1-((S)-3-amino-1-((S)-3-cyclopentyl-1-((S)-2-(1-ethyl-4-phenyl-1H-imidazol-2-yl)pyrrolidin-1-yl)-1-oxopropan-2-ylamino)-1-oxopropan-2-ylamino)-3-methyl-1-oxobutan-2-yl)pyrrolidine-2-carboxamide ID: ALA4216933
PubChem CID: 145971421
Max Phase: Preclinical
Molecular Formula: C44H67N9O6
Molecular Weight: 818.08
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(-c2ccccc2)nc1[C@@H]1CCCN1C(=O)[C@H](CC1CCCC1)NC(=O)[C@H](CN)NC(=O)[C@@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(C)C)NC(C)=O)C(C)C
Standard InChI: InChI=1S/C44H67N9O6/c1-7-51-26-35(31-17-9-8-10-18-31)47-39(51)36-19-13-21-52(36)44(59)33(24-30-15-11-12-16-30)48-40(55)34(25-45)49-42(57)38(28(4)5)50-41(56)37-20-14-22-53(37)43(58)32(23-27(2)3)46-29(6)54/h8-10,17-18,26-28,30,32-34,36-38H,7,11-16,19-25,45H2,1-6H3,(H,46,54)(H,48,55)(H,49,57)(H,50,56)/t32-,33-,34-,36-,37-,38-/m0/s1
Standard InChI Key: WPGWVGAREBBLSP-ABSZIYDWSA-N
Molfile:
RDKit 2D
59 63 0 0 0 0 0 0 0 0999 V2000
6.9788 -3.1726 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7440 -2.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4250 -4.1147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4460 -3.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6787 -2.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4393 -2.5430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8729 -1.8360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1739 -2.8936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8810 -3.3273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6298 -2.1063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6089 -2.9336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8600 -4.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5631 -4.5892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3137 -3.3624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0394 -2.9700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4704 -3.0109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7424 -3.4047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0603 -2.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7882 -1.7491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7215 -4.2320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4276 -4.6616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1765 -3.4406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1555 -4.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4027 -5.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8586 -4.7025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6236 -4.3867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1633 -5.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9239 -5.5276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7286 -5.7192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1357 -4.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6774 -5.8800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9365 -5.5249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3672 -6.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7574 -6.8454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5676 -6.6984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9725 -3.9938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2561 -4.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6824 -4.4111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5461 -3.9826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2496 -5.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9596 -5.6409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9531 -6.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6760 -5.2347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8296 -4.3889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8232 -5.2123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1196 -3.9714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6163 -3.5617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2795 -3.0709 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0176 -2.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1925 -2.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9446 -3.0827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7026 -1.6339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0340 -0.8812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5447 -0.2196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7256 -0.3127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3981 -1.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8894 -1.7312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0649 -3.3184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2432 -4.1225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 8 1 0
11 14 1 0
17 20 1 0
23 25 1 0
1 2 1 0
2 4 1 1
4 3 2 0
2 5 1 0
6 7 1 0
7 5 1 0
6 1 1 0
9 8 1 6
9 11 1 0
11 10 2 0
9 12 1 0
12 13 1 0
14 15 1 0
15 17 1 0
17 16 2 0
15 18 1 1
18 19 1 0
21 20 1 6
21 23 1 0
23 22 2 0
21 24 1 0
25 26 1 0
26 27 1 0
28 29 1 0
29 27 1 0
28 25 1 0
12 30 1 0
24 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 31 1 0
1 36 1 0
36 37 1 0
36 38 2 0
37 39 1 0
37 40 1 6
40 41 1 0
41 42 1 0
41 43 1 0
39 44 1 0
44 45 2 0
44 46 1 0
26 47 1 6
47 48 1 0
48 49 1 0
49 50 2 0
50 51 1 0
51 47 2 0
50 52 1 0
52 53 2 0
53 54 1 0
54 55 2 0
55 56 1 0
56 57 2 0
57 52 1 0
48 58 1 0
58 59 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 818.08Molecular Weight (Monoisotopic): 817.5214AlogP: 3.42#Rotatable Bonds: 18Polar Surface Area: 200.86Molecular Species: NEUTRALHBA: 9HBD: 5#RO5 Violations: 1HBA (Lipinski): 15HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.83CX Basic pKa: 8.09CX LogP: 2.58CX LogD: 1.82Aromatic Rings: 2Heavy Atoms: 59QED Weighted: 0.15Np Likeness Score: -0.38
References 1. Du L, Grigsby SM, Yao A, Chang Y, Johnson G, Sun H, Nikolovska-Coleska Z.. (2018) Peptidomimetics for Targeting Protein-Protein Interactions between DOT1L and MLL Oncofusion Proteins AF9 and ENL., 9 (9): [PMID:30258537 ] [10.1021/acsmedchemlett.8b00175 ]
