1-(2,4-dimethoxy-5-chlorophenyl)-4-(3-(methylphenylacetate-4-yl-oxy)-2-hydroxypropyl)-piperazine

ID: ALA4217017

PubChem CID: 145971425

Max Phase: Preclinical

Molecular Formula: C24H31ClN2O6

Molecular Weight: 478.97

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)Cc1ccc(OCC(O)CN2CCN(c3cc(Cl)c(OC)cc3OC)CC2)cc1

Standard InChI:  InChI=1S/C24H31ClN2O6/c1-30-22-14-23(31-2)21(13-20(22)25)27-10-8-26(9-11-27)15-18(28)16-33-19-6-4-17(5-7-19)12-24(29)32-3/h4-7,13-14,18,28H,8-12,15-16H2,1-3H3

Standard InChI Key:  PXUMDRPFLZJZEQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    1.5339  -10.3469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5328  -11.1665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2408  -11.5754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9505  -11.1660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9476  -10.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2390   -9.9381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2366   -9.1209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9431   -8.7102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6520   -9.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3585   -8.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6544   -9.9338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0674   -9.1124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0643   -9.9266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7691  -10.3330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4780   -9.9258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4776   -9.1076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7682   -8.6967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1841  -10.3345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1821  -11.1528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8886  -11.5619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5977  -11.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5957  -10.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8886   -9.9270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2406  -12.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5328  -12.8010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5326  -13.6182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8252  -12.3923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1174  -12.8007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4736  -11.5601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3056  -11.5620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3060  -12.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4722  -12.3773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3023   -9.9219    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 10 12  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 15 18  1  0
  3 24  1  0
 24 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 19 29  1  0
 21 30  1  0
 30 31  1  0
 29 32  1  0
 22 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4217017

    ---

Associated Targets(non-human)

Thoracic aorta (57 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 478.97Molecular Weight (Monoisotopic): 478.1871AlogP: 2.63#Rotatable Bonds: 10
Polar Surface Area: 80.70Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.08CX LogP: 3.01CX LogD: 2.84
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.52Np Likeness Score: -0.99

References

1. Huang JJ, Zhang ZH, He F, Liu XW, Xu XJ, Dai LJ, Liu QM, Yuan M..  (2018)  Novel naftopidil derivatives containing methyl phenylacetate and their blocking effects on α1D/1A-adrenoreceptor subtypes.,  28  (4): [PMID:29422390] [10.1016/j.bmcl.2018.01.068]

Source