The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2,4-dimethoxy-5-chlorophenyl)-4-(3-(methylphenylacetate-4-yl-oxy)-2-hydroxypropyl)-piperazine ID: ALA4217017
PubChem CID: 145971425
Max Phase: Preclinical
Molecular Formula: C24H31ClN2O6
Molecular Weight: 478.97
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)Cc1ccc(OCC(O)CN2CCN(c3cc(Cl)c(OC)cc3OC)CC2)cc1
Standard InChI: InChI=1S/C24H31ClN2O6/c1-30-22-14-23(31-2)21(13-20(22)25)27-10-8-26(9-11-27)15-18(28)16-33-19-6-4-17(5-7-19)12-24(29)32-3/h4-7,13-14,18,28H,8-12,15-16H2,1-3H3
Standard InChI Key: PXUMDRPFLZJZEQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
1.5339 -10.3469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5328 -11.1665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2408 -11.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9505 -11.1660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9476 -10.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2390 -9.9381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2366 -9.1209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9431 -8.7102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6520 -9.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3585 -8.7059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6544 -9.9338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0674 -9.1124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0643 -9.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7691 -10.3330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4780 -9.9258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4776 -9.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7682 -8.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1841 -10.3345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1821 -11.1528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8886 -11.5619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5977 -11.1538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5957 -10.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8886 -9.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2406 -12.3926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5328 -12.8010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5326 -13.6182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8252 -12.3923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1174 -12.8007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4736 -11.5601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3056 -11.5620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3060 -12.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4722 -12.3773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3023 -9.9219 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 1 0
10 12 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
3 24 1 0
24 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
19 29 1 0
21 30 1 0
30 31 1 0
29 32 1 0
22 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.97Molecular Weight (Monoisotopic): 478.1871AlogP: 2.63#Rotatable Bonds: 10Polar Surface Area: 80.70Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.08CX LogP: 3.01CX LogD: 2.84Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.52Np Likeness Score: -0.99
References 1. Huang JJ, Zhang ZH, He F, Liu XW, Xu XJ, Dai LJ, Liu QM, Yuan M.. (2018) Novel naftopidil derivatives containing methyl phenylacetate and their blocking effects on α1D/1A-adrenoreceptor subtypes., 28 (4): [PMID:29422390 ] [10.1016/j.bmcl.2018.01.068 ]