The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-methoxy-4'-((2-methoxyethoxy)methoxy)-3'-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)biphenyl-4-carboxylic acid ID: ALA4217018
PubChem CID: 145971426
Max Phase: Preclinical
Molecular Formula: C32H38O6
Molecular Weight: 518.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCOCOc1ccc(-c2ccc(C(=O)O)cc2OC)cc1-c1ccc2c(c1)C(C)(C)CCC2(C)C
Standard InChI: InChI=1S/C32H38O6/c1-31(2)13-14-32(3,4)27-18-22(8-11-26(27)31)25-17-21(9-12-28(25)38-20-37-16-15-35-5)24-10-7-23(30(33)34)19-29(24)36-6/h7-12,17-19H,13-16,20H2,1-6H3,(H,33,34)
Standard InChI Key: OQAVFHFHWXHPBW-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
15.2955 -9.3028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8910 -8.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4821 -9.3002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4783 -6.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8910 -6.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2995 -6.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1894 -7.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1894 -8.1925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6000 -7.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5984 -8.1907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3026 -8.5980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0089 -8.1911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0065 -7.3726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3017 -6.9690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7100 -6.9603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4193 -7.3684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1252 -6.9582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1230 -6.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4090 -5.7340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7060 -6.1465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8299 -7.3630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8308 -8.1812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5388 -8.5878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2464 -8.1773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2415 -7.3559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5329 -6.9530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9959 -5.7421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9911 -4.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2809 -4.5206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2761 -3.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5659 -3.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5611 -2.4818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8510 -2.0775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9581 -8.5839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9614 -9.4010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6642 -8.1724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5285 -6.1358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2339 -5.7233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 1 0
7 5 1 0
8 2 1 0
2 10 1 0
9 5 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
13 15 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
17 21 1 0
20 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
34 35 1 0
34 36 2 0
24 34 1 0
26 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.65Molecular Weight (Monoisotopic): 518.2668AlogP: 7.08#Rotatable Bonds: 10Polar Surface Area: 74.22Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.90CX Basic pKa: ┄CX LogP: 7.25CX LogD: 4.04Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.23Np Likeness Score: 0.14
References 1. Thoreau E, Arlabosse JM, Bouix-Peter C, Chambon S, Chantalat L, Daver S, Dumais L, Duvert G, Feret A, Ouvry G, Pascau J, Raffin C, Rodeville N, Soulet C, Tabet S, Talano S, Portal T.. (2018) Structure-based design of Trifarotene (CD5789), a potent and selective RARγ agonist for the treatment of acne., 28 (10): [PMID:29706423 ] [10.1016/j.bmcl.2018.04.036 ]