2-methoxy-4'-((2-methoxyethoxy)methoxy)-3'-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)biphenyl-4-carboxylic acid

ID: ALA4217018

PubChem CID: 145971426

Max Phase: Preclinical

Molecular Formula: C32H38O6

Molecular Weight: 518.65

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCOCOc1ccc(-c2ccc(C(=O)O)cc2OC)cc1-c1ccc2c(c1)C(C)(C)CCC2(C)C

Standard InChI:  InChI=1S/C32H38O6/c1-31(2)13-14-32(3,4)27-18-22(8-11-26(27)31)25-17-21(9-12-28(25)38-20-37-16-15-35-5)24-10-7-23(30(33)34)19-29(24)36-6/h7-12,17-19H,13-16,20H2,1-6H3,(H,33,34)

Standard InChI Key:  OQAVFHFHWXHPBW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   15.2955   -9.3028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8910   -8.5970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4821   -9.3002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4783   -6.2528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8910   -6.9626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2995   -6.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1894   -7.3754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1894   -8.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6000   -7.3754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5984   -8.1907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3026   -8.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0089   -8.1911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0065   -7.3726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3017   -6.9690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7100   -6.9603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4193   -7.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1252   -6.9582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1230   -6.1401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4090   -5.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7060   -6.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8299   -7.3630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8308   -8.1812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5388   -8.5878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2464   -8.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2415   -7.3559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5329   -6.9530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9959   -5.7421    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9911   -4.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2809   -4.5206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2761   -3.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5659   -3.2990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5611   -2.4818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8510   -2.0775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9581   -8.5839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9614   -9.4010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6642   -8.1724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5285   -6.1358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2339   -5.7233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
  7  8  1  0
  7  5  1  0
  8  2  1  0
  2 10  1  0
  9  5  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 17 21  1  0
 20 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 34 35  1  0
 34 36  2  0
 24 34  1  0
 26 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4217018

    ---

Associated Targets(Human)

RARG Tclin Retinoic acid receptor gamma (1154 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 518.65Molecular Weight (Monoisotopic): 518.2668AlogP: 7.08#Rotatable Bonds: 10
Polar Surface Area: 74.22Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.90CX Basic pKa: CX LogP: 7.25CX LogD: 4.04
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.23Np Likeness Score: 0.14

References

1. Thoreau E, Arlabosse JM, Bouix-Peter C, Chambon S, Chantalat L, Daver S, Dumais L, Duvert G, Feret A, Ouvry G, Pascau J, Raffin C, Rodeville N, Soulet C, Tabet S, Talano S, Portal T..  (2018)  Structure-based design of Trifarotene (CD5789), a potent and selective RARγ agonist for the treatment of acne.,  28  (10): [PMID:29706423] [10.1016/j.bmcl.2018.04.036]

Source