The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-bromophenylsulfonyl)-5,7-dimethoxy-2-(4-methoxyphenyl)quinolin-4(1H)-one ID: ALA4217108
PubChem CID: 145971668
Max Phase: Preclinical
Molecular Formula: C24H20BrNO6S
Molecular Weight: 530.40
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc(=O)c3c(OC)cc(OC)cc3n2S(=O)(=O)c2cccc(Br)c2)cc1
Standard InChI: InChI=1S/C24H20BrNO6S/c1-30-17-9-7-15(8-10-17)20-14-22(27)24-21(12-18(31-2)13-23(24)32-3)26(20)33(28,29)19-6-4-5-16(25)11-19/h4-14H,1-3H3
Standard InChI Key: JLOXUAKLSAJIKV-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
43.0635 -10.1158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.6590 -10.8257 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
43.4760 -10.8211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.5486 -12.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5475 -12.8834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2555 -13.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2537 -11.6550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9623 -12.0603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9657 -12.8809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6741 -13.2861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3838 -12.8751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3804 -12.0544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6674 -11.6448 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.6764 -14.1032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.0856 -11.6443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7948 -12.0524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.5008 -11.6423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4987 -10.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7848 -10.4181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0817 -10.8305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.2046 -10.4126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.9141 -10.8180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8408 -11.6554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.2560 -14.1095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.5486 -14.5186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1332 -12.0642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9530 -10.4229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9510 -9.6062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2419 -9.2016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5354 -9.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5426 -10.4355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2522 -10.8365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2378 -8.3844 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
10 14 2 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
12 15 1 0
18 21 1 0
21 22 1 0
4 23 1 0
6 24 1 0
24 25 1 0
23 26 1 0
13 2 1 0
2 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
29 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 530.40Molecular Weight (Monoisotopic): 529.0195AlogP: 4.69#Rotatable Bonds: 6Polar Surface Area: 83.83Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.13CX LogD: 4.13Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: -0.52
References 1. Ling T, Lang W, Feng X, Das S, Maier J, Jeffries C, Shelat A, Rivas F.. (2018) Novel vitexin-inspired scaffold against leukemia., 146 [PMID:29407975 ] [10.1016/j.ejmech.2018.01.004 ]