The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 6-(3-(2,3-dihydrobenzo[b][1,4]dioxin-6-yl)ureido)-4-oxo-1,4-dihydroquinoline-2-carboxylate ID: ALA4217304
PubChem CID: 145972865
Max Phase: Preclinical
Molecular Formula: C20H17N3O6
Molecular Weight: 395.37
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1cc(=O)c2cc(NC(=O)Nc3ccc4c(c3)OCCO4)ccc2[nH]1
Standard InChI: InChI=1S/C20H17N3O6/c1-27-19(25)15-10-16(24)13-8-11(2-4-14(13)23-15)21-20(26)22-12-3-5-17-18(9-12)29-7-6-28-17/h2-5,8-10H,6-7H2,1H3,(H,23,24)(H2,21,22,26)
Standard InChI Key: NHOCBJUTPBPDCR-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
24.3754 -3.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2094 -3.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2083 -3.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9163 -4.2331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9145 -2.5957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6231 -3.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6265 -3.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3349 -4.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0446 -3.8158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0412 -2.9952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3282 -2.5855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3372 -5.0440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.7477 -2.5844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7451 -1.7672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4566 -2.9908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4592 -3.8080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5002 -4.2322 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7928 -3.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7935 -3.0058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0848 -4.2310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3779 -3.0018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9622 -3.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6713 -4.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9592 -3.0024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6707 -2.5966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6749 -1.7821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9695 -1.3673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2580 -1.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2521 -2.5937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
6 11 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
8 12 2 0
10 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
3 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
20 1 1 0
1 21 2 0
21 25 1 0
24 22 1 0
22 23 2 0
23 1 1 0
24 25 2 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 395.37Molecular Weight (Monoisotopic): 395.1117AlogP: 2.73#Rotatable Bonds: 3Polar Surface Area: 118.75Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.79CX Basic pKa: ┄CX LogP: 2.62CX LogD: 1.99Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.59Np Likeness Score: -0.94
References 1. Ling T, Lang W, Feng X, Das S, Maier J, Jeffries C, Shelat A, Rivas F.. (2018) Novel vitexin-inspired scaffold against leukemia., 146 [PMID:29407975 ] [10.1016/j.ejmech.2018.01.004 ]