The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[(1R,2S)-1-({[5-[(Dimethylamino)methyl]-2-(trifluoromethoxy)phenyl]amino}carbonyl)-2-(1H-indol-3-yl)propyl]-4-(4-fluoro-2-methylphenyl)-3-oxopiperazine-1-carboxamide ID: ALA4217405
PubChem CID: 11563877
Max Phase: Preclinical
Molecular Formula: C34H36F4N6O4
Molecular Weight: 668.69
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(F)ccc1N1CCN(C(=O)N[C@@H](C(=O)Nc2cc(CN(C)C)ccc2OC(F)(F)F)[C@@H](C)c2c[nH]c3ccccc23)CC1=O
Standard InChI: InChI=1S/C34H36F4N6O4/c1-20-15-23(35)10-11-28(20)44-14-13-43(19-30(44)45)33(47)41-31(21(2)25-17-39-26-8-6-5-7-24(25)26)32(46)40-27-16-22(18-42(3)4)9-12-29(27)48-34(36,37)38/h5-12,15-17,21,31,39H,13-14,18-19H2,1-4H3,(H,40,46)(H,41,47)/t21-,31+/m0/s1
Standard InChI Key: HUSUOHXIMXAZBI-JCOAXYOVSA-N
Molfile:
RDKit 2D
48 52 0 0 0 0 0 0 0 0999 V2000
11.6553 -4.3542 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.0775 -4.9362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8704 -5.1456 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.0496 -10.6589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3416 -11.0622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3354 -11.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0414 -12.2933 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7536 -11.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7556 -11.0687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0557 -9.8418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7637 -9.4344 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3497 -9.4279 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0394 -13.1105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3517 -8.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6457 -8.1968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6518 -7.3796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9787 -9.4985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7857 -9.3728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9153 -8.5677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1904 -8.1900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9832 -7.4010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1974 -7.1861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6147 -7.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8220 -8.5532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6119 -8.7681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0638 -8.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7698 -8.6172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0658 -7.3902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7780 -6.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7800 -6.1656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4921 -5.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1981 -6.1721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1920 -6.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4840 -7.3967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0740 -5.7559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8980 -7.4032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6060 -6.9958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6122 -6.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3120 -7.4097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3755 -4.5248 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.3310 -13.5151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3286 -14.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0358 -14.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7469 -14.3314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7457 -13.5163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0349 -15.5598 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.6248 -12.2830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4527 -13.1065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
4 9 1 0
10 11 2 0
10 12 1 0
4 10 1 0
7 13 1 0
14 15 1 0
15 16 1 6
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
17 25 1 0
20 25 2 0
15 19 1 0
26 27 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
29 34 2 0
35 2 1 0
30 35 1 0
37 38 1 0
37 39 1 0
36 37 1 0
33 36 1 0
28 29 1 0
26 28 1 0
14 26 1 0
14 12 1 6
2 40 1 0
13 41 2 0
41 42 1 0
42 43 2 0
43 44 1 0
44 45 2 0
45 13 1 0
43 46 1 0
6 47 2 0
45 48 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 668.69Molecular Weight (Monoisotopic): 668.2734AlogP: 5.74#Rotatable Bonds: 9Polar Surface Area: 110.01Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.67CX Basic pKa: 8.16CX LogP: 5.54CX LogD: 4.71Aromatic Rings: 4Heavy Atoms: 48QED Weighted: 0.20Np Likeness Score: -1.46
References 1. Banno Y, Sasaki S, Kamata M, Kunitomo J, Miyamoto Y, Abe H, Taya N, Oi S, Watanabe M, Urushibara T, Hazama M, Niwa SI, Miyamoto S, Horinouchi A, Kuroshima KI, Amano N, Matsumoto SI, Matsunaga S.. (2017) Design and synthesis of a novel series of orally active, selective somatostatin receptor 2 agonists for the treatment of type 2 diabetes., 25 (21): [PMID:28988629 ] [10.1016/j.bmc.2017.09.031 ]