The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Dragonin B ID: ALA4217625
PubChem CID: 145973109
Max Phase: Preclinical
Molecular Formula: C35H34O8
Molecular Weight: 582.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC1=C(CCC(=O)c2ccccc2)C(=O)C(C)=C2O[C@@]3(c4ccccc4)Oc4cc(O)c(C)c(OC)c4[C@H]([C@@H]3O)[C@]21C
Standard InChI: InChI=1S/C35H34O8/c1-19-25(37)18-26-27(30(19)40-4)28-31(39)35(42-26,22-14-10-7-11-15-22)43-32-20(2)29(38)23(33(41-5)34(28,32)3)16-17-24(36)21-12-8-6-9-13-21/h6-15,18,28,31,37,39H,16-17H2,1-5H3/t28-,31+,34-,35-/m1/s1
Standard InChI Key: OSIZNVHDTSBGNO-WTRAPAKSSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
17.1836 -4.7133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3254 -4.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3243 -4.9055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0323 -5.3144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0305 -3.6771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7391 -4.0823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7379 -4.9075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4480 -5.3188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1639 -4.9096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1651 -4.0844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4504 -3.6685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6176 -3.6775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6162 -5.3135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0320 -6.1316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3242 -6.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1836 -5.5305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4759 -5.9391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4759 -6.7518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1820 -7.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8897 -6.7534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8913 -5.9346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8680 -3.6691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5786 -4.0731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2811 -3.6586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2733 -2.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5573 -2.4404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8578 -2.8573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4523 -4.4987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5985 -5.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5970 -7.1627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7676 -7.1594 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7665 -7.9766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7660 -6.3436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1469 -6.0629 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.1808 -7.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4726 -8.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4714 -9.2040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7631 -9.6116 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1786 -9.6136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1736 -10.4306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8800 -10.8401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5892 -10.4324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5877 -9.6110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8808 -9.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16 1 1 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
6 11 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
2 12 1 0
3 13 1 0
4 14 1 0
14 15 1 0
8 17 1 0
10 1 1 0
16 17 1 0
16 21 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
10 22 1 1
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
9 28 1 1
21 29 1 0
20 30 2 0
18 31 1 0
31 32 1 0
17 33 1 1
8 34 1 1
19 35 1 0
35 36 1 0
36 37 1 0
37 38 2 0
37 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 582.65Molecular Weight (Monoisotopic): 582.2254AlogP: 5.86#Rotatable Bonds: 7Polar Surface Area: 111.52Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.95CX Basic pKa: ┄CX LogP: 5.47CX LogD: 5.47Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.33Np Likeness Score: 1.36
References 1. Kuo PC, Hung HY, Hwang TL, Du WK, Ku HC, Lee EJ, Tai SH, Chen FA, Wu TS.. (2017) Anti-inflammatory Flavan-3-ol-dihydroretrochalcones from Daemonorops draco., 80 (4): [PMID:28398735 ] [10.1021/acs.jnatprod.7b00039 ]