3-(5-Aminothiazolo[5,4-d]pyrimidin-7-yl)-N-(4-methoxyphenyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxamide

ID: ALA4217771

PubChem CID: 145974272

Max Phase: Preclinical

Molecular Formula: C19H21N7O2S

Molecular Weight: 411.49

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(NC(=O)N2C3CCC2CN(c2nc(N)nc4scnc24)C3)cc1

Standard InChI:  InChI=1S/C19H21N7O2S/c1-28-14-6-2-11(3-7-14)22-19(27)26-12-4-5-13(26)9-25(8-12)16-15-17(29-10-21-15)24-18(20)23-16/h2-3,6-7,10,12-13H,4-5,8-9H2,1H3,(H,22,27)(H2,20,23,24)

Standard InChI Key:  QYIQGRIZKFLIBT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
   15.3766  -13.5414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3755  -14.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0877  -14.7823    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0859  -13.1284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8027  -13.5378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8076  -14.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6002  -14.6190    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.0843  -13.9461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5924  -13.2748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6592  -14.7814    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0834  -12.3030    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8001  -11.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7996  -11.0670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0842  -10.6525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3718  -11.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3706  -11.8942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0849   -9.8271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3734   -9.4138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8011   -9.4149    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5168   -9.8282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5126  -10.6534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2274  -11.0666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9405  -10.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9385   -9.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2273   -9.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6567  -11.0668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6571  -11.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4099  -11.7461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7578  -11.7337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  2 10  1  0
  4 11  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 14 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
 26 27  1  0
 13 28  1  0
 28 29  1  0
 15 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4217771

    ---

Associated Targets(Human)

PI4KB Tchem PI4-kinase beta subunit (1593 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KCNH2 Tclin HERG (29587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CYP3A4 Tclin Cytochrome P450 3A4 (53859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.49Molecular Weight (Monoisotopic): 411.1477AlogP: 2.56#Rotatable Bonds: 3
Polar Surface Area: 109.50Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.97CX Basic pKa: 4.35CX LogP: 2.46CX LogD: 2.46
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.68Np Likeness Score: -1.21

References

1. Reuberson J, Horsley H, Franklin RJ, Ford D, Neuss J, Brookings D, Huang Q, Vanderhoydonck B, Gao LJ, Jang MY, Herdewijn P, Ghawalkar A, Fallah-Arani F, Khan AR, Henshall J, Jairaj M, Malcolm S, Ward E, Shuttleworth L, Lin Y, Li S, Louat T, Waer M, Herman J, Payne A, Ceska T, Doyle C, Pitt W, Calmiano M, Augustin M, Steinbacher S, Lammens A, Allen R..  (2018)  Discovery of a Potent, Orally Bioavailable PI4KIIIβ Inhibitor (UCB9608) Able To Significantly Prolong Allogeneic Organ Engraftment in Vivo.,  61  (15): [PMID:29952567] [10.1021/acs.jmedchem.8b00521]

Source