The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-((S)-2-acetamido-4-methylpentanoyl)-N-((2S,3S)-1-((S)-1-((S)-1-((S)-2-((S)-1-(dimethylamino)-4-methyl-1-oxopentan-2-ylcarbamoyl)pyrrolidin-1-yl)-3-(1H-indol-3-yl)-1-oxopropan-2-ylamino)-3-hydroxy-1-oxopropan-2-ylamino)-3-methyl-1-oxopentan-2-yl)pyrrolidine-2-carboxamide ID: ALA4217882
PubChem CID: 145974994
Max Phase: Preclinical
Molecular Formula: C46H71N9O9
Molecular Weight: 894.13
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](C)[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(C)C)NC(C)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N(C)C
Standard InChI: InChI=1S/C46H71N9O9/c1-10-28(6)39(52-42(60)38-18-14-20-55(38)45(63)34(22-27(4)5)48-29(7)57)43(61)51-36(25-56)40(58)49-35(23-30-24-47-32-16-12-11-15-31(30)32)46(64)54-19-13-17-37(54)41(59)50-33(21-26(2)3)44(62)53(8)9/h11-12,15-16,24,26-28,33-39,47,56H,10,13-14,17-23,25H2,1-9H3,(H,48,57)(H,49,58)(H,50,59)(H,51,61)(H,52,60)/t28-,33-,34-,35-,36-,37-,38-,39-/m0/s1
Standard InChI Key: GZSANHPVWZFCSI-PJKCPVONSA-N
Molfile:
RDKit 2D
64 67 0 0 0 0 0 0 0 0999 V2000
3.2031 -2.8760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7693 -3.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1423 -3.8828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5722 -3.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5366 -4.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7673 -2.4799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5304 -2.1649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2098 -3.4196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2306 -2.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4653 -1.3419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2290 -1.8521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6616 -1.1468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9566 -2.2017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6619 -2.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4089 -1.4164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3881 -2.2416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6411 -3.4595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3423 -3.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0942 -2.6682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8194 -2.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2467 -2.3158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5207 -2.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8404 -1.4498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5700 -1.0563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4998 -3.5337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2041 -3.9621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9510 -2.7443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9302 -3.5695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1792 -4.7883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6314 -4.0030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3945 -3.6880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0193 -2.2851 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5896 -2.8843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9327 -4.3159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6965 -4.8260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4992 -5.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3919 -2.6921 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6245 -1.9005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4273 -1.7080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0583 -1.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2909 -0.5088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7247 0.0942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4039 -3.0654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1682 -3.8523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1027 -4.8630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9012 -4.6705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8701 -5.6508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8401 -2.4679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0999 -0.3184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9926 -2.3041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6609 -0.9205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7589 -3.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7914 -2.1127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9185 -3.8503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8958 -4.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4557 -5.1774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7187 -4.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1510 -5.4127 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3484 -5.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5435 -6.1342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2680 -6.9021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7961 -7.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6033 -7.3769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8751 -6.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 6 1 0
9 13 1 0
16 19 1 0
22 25 1 0
28 30 1 0
33 37 1 0
2 1 1 6
2 4 1 0
4 3 2 0
2 5 1 0
6 7 1 0
7 9 1 1
9 8 2 0
7 10 1 0
11 12 1 0
12 10 1 0
11 6 1 0
14 13 1 6
14 16 1 0
16 15 2 0
14 17 1 0
17 18 1 1
19 20 1 0
20 22 1 0
22 21 2 0
20 23 1 1
23 24 1 0
26 25 1 6
26 28 1 0
28 27 2 0
26 29 1 0
30 31 1 0
31 33 1 6
33 32 2 0
31 34 1 0
35 36 1 0
36 34 1 0
35 30 1 0
37 38 1 0
38 39 1 0
38 40 1 1
40 41 1 0
41 49 1 0
41 42 1 0
1 43 1 0
43 44 1 0
5 45 1 0
45 46 1 0
45 47 1 0
43 48 2 0
39 50 1 0
39 51 2 0
50 52 1 0
50 53 1 0
17 54 1 0
54 55 1 0
29 56 1 0
56 57 2 0
57 58 1 0
58 60 1 0
59 56 1 0
59 60 2 0
60 61 1 0
61 62 2 0
62 63 1 0
63 64 2 0
64 59 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 894.13Molecular Weight (Monoisotopic): 893.5375AlogP: 1.36#Rotatable Bonds: 21Polar Surface Area: 242.45Molecular Species: NEUTRALHBA: 9HBD: 7#RO5 Violations: 2HBA (Lipinski): 18HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.63CX Basic pKa: ┄CX LogP: 0.76CX LogD: 0.76Aromatic Rings: 2Heavy Atoms: 64QED Weighted: 0.10Np Likeness Score: -0.20
References 1. Du L, Grigsby SM, Yao A, Chang Y, Johnson G, Sun H, Nikolovska-Coleska Z.. (2018) Peptidomimetics for Targeting Protein-Protein Interactions between DOT1L and MLL Oncofusion Proteins AF9 and ENL., 9 (9): [PMID:30258537 ] [10.1021/acsmedchemlett.8b00175 ]