(5R,5aR,8aR,9R)-9-(2-Oxo-but-3-enyl)-5-(3,4,5-trimethoxy-phenyl)-5,8,8a,9-tetrahydro-5aH-furo[3',4':6,7]naphtho[2,3-d][1,3]dioxol-6-one

ID: ALA4217889

PubChem CID: 145974766

Max Phase: Preclinical

Molecular Formula: C26H26O8

Molecular Weight: 466.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC(=O)C[C@H]1c2cc3c(cc2[C@@H](c2cc(OC)c(OC)c(OC)c2)[C@H]2C(=O)OC[C@@H]21)OCO3

Standard InChI:  InChI=1S/C26H26O8/c1-5-14(27)8-15-16-9-19-20(34-12-33-19)10-17(16)23(24-18(15)11-32-26(24)28)13-6-21(29-2)25(31-4)22(7-13)30-3/h5-7,9-10,15,18,23-24H,1,8,11-12H2,2-4H3/t15-,18+,23+,24-/m0/s1

Standard InChI Key:  UXCCSCQRJRDBFI-IWFYKTFHSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    4.4528   -4.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4528   -2.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7475   -4.0942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7501   -3.2747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0422   -2.8666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0412   -4.5039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4524   -5.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7430   -5.7313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7427   -6.5518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4509   -6.9654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1651   -6.5483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1620   -5.7291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1622   -3.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1667   -4.0907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9460   -4.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4249   -3.6770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9388   -3.0173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3327   -4.0954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3270   -3.2767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5464   -3.0304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0681   -3.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5557   -4.3565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4514   -2.0389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1625   -1.6249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1611   -0.8036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8750   -2.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5862   -1.6224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2069   -5.1220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4520   -7.7867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0307   -6.9642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8784   -6.9585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8813   -7.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7448   -8.1962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3190   -6.5512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1590   -4.9114    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1549   -2.4516    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0
  3  1  1  0
  1 14  1  0
 13  2  1  0
  3  4  2  0
  4  5  1  0
  5 19  2  0
 18  6  2  0
  6  3  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  1  7  1  6
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 18  1  0
  2 23  1  6
 23 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  2  0
 15 28  2  0
 10 29  1  0
  9 30  1  0
 11 31  1  0
 31 32  1  0
 29 33  1  0
 30 34  1  0
 14 35  1  1
 13 36  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4217889

    ---

Associated Targets(Human)

K562/Adr (229 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 466.49Molecular Weight (Monoisotopic): 466.1628AlogP: 3.60#Rotatable Bonds: 7
Polar Surface Area: 89.52Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.31CX LogD: 3.31
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: 1.39

References

1. Zhang X, Rakesh KP, Shantharam CS, Manukumar HM, Asiri AM, Marwani HM, Qin HL..  (2018)  Podophyllotoxin derivatives as an excellent anticancer aspirant for future chemotherapy: A key current imminent needs.,  26  (2): [PMID:29269253] [10.1016/j.bmc.2017.11.026]

Source