The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,7-dimethoxy-N-(4-morpholinophenyl)-4-oxo-1,4-dihydroquinoline-2-carboxamide ID: ALA4218042
PubChem CID: 145967519
Max Phase: Preclinical
Molecular Formula: C22H23N3O5
Molecular Weight: 409.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)c2c(=O)cc(C(=O)Nc3ccc(N4CCOCC4)cc3)[nH]c2c1
Standard InChI: InChI=1S/C22H23N3O5/c1-28-16-11-17-21(20(12-16)29-2)19(26)13-18(24-17)22(27)23-14-3-5-15(6-4-14)25-7-9-30-10-8-25/h3-6,11-13H,7-10H2,1-2H3,(H,23,27)(H,24,26)
Standard InChI Key: DEFGQHFKNBWHHO-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
19.4915 -25.2586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4903 -26.0781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1984 -26.4871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1966 -24.8497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9052 -25.2550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9086 -26.0756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6170 -26.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3267 -26.0698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3233 -25.2492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6103 -24.8395 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6192 -27.2980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7837 -24.8502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1989 -27.3043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4915 -27.7134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0761 -25.2589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0297 -24.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7387 -25.2448 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0272 -24.0212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7412 -26.0620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0341 -26.4684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0363 -27.2848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7458 -27.6920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4545 -27.2768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4489 -26.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7510 -28.5066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0433 -28.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0449 -29.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7526 -30.1401 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4603 -29.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4603 -28.9097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
7 11 2 0
1 12 1 0
3 13 1 0
13 14 1 0
12 15 1 0
9 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
25 26 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
22 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 409.44Molecular Weight (Monoisotopic): 409.1638AlogP: 2.63#Rotatable Bonds: 5Polar Surface Area: 92.89Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.89CX Basic pKa: 1.02CX LogP: 2.59CX LogD: 2.59Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.67Np Likeness Score: -0.92
References 1. Ling T, Lang W, Feng X, Das S, Maier J, Jeffries C, Shelat A, Rivas F.. (2018) Novel vitexin-inspired scaffold against leukemia., 146 [PMID:29407975 ] [10.1016/j.ejmech.2018.01.004 ]