The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6\"-4-hydroxybenzoyl rhaponticin ID: ALA4218215
PubChem CID: 145970760
Max Phase: Preclinical
Molecular Formula: C28H28O11
Molecular Weight: 540.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C/c2cc(O)cc(O[C@@H]3O[C@H](COC(=O)c4ccc(O)cc4)[C@@H](O)[C@H](O)[C@H]3O)c2)cc1O
Standard InChI: InChI=1S/C28H28O11/c1-36-22-9-4-15(12-21(22)31)2-3-16-10-19(30)13-20(11-16)38-28-26(34)25(33)24(32)23(39-28)14-37-27(35)17-5-7-18(29)8-6-17/h2-13,23-26,28-34H,14H2,1H3/b3-2+/t23-,24-,25+,26-,28-/m1/s1
Standard InChI Key: JSNZZWURTDZGLL-LZRUTRTESA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
15.3179 -10.4894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3179 -12.1595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8895 -12.9779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4527 -12.1596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8894 -10.4978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4573 -9.6619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6016 -10.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6016 -11.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8894 -12.1512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1732 -11.7399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1732 -10.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4527 -10.4895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3337 -9.2615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1859 -10.4894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8976 -10.9056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0621 -9.6819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4658 -10.9015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0421 -11.7257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6219 -9.6736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0380 -10.9015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7540 -12.1378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6177 -10.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0538 -10.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7498 -10.4894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4699 -11.7257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3337 -10.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7947 -9.2782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7540 -12.9619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7458 -9.2460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7502 -8.4218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0298 -9.6541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3195 -9.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6040 -9.6442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5991 -10.4691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3156 -10.8850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0282 -10.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8836 -10.8783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5001 -9.7044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7638 -10.9288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6 12 1 0
11 5 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 1
7 1 1 1
8 2 1 6
9 3 1 1
10 4 1 6
14 15 2 0
15 22 1 0
16 13 1 0
17 14 1 0
18 21 1 0
19 13 2 0
20 24 1 0
21 25 2 0
22 19 1 0
23 16 2 0
24 17 2 0
25 17 1 0
26 22 2 0
27 16 1 0
1 20 1 0
28 21 1 0
23 26 1 0
18 20 2 0
6 29 1 0
29 30 2 0
29 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
34 37 1 0
27 38 1 0
23 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.52Molecular Weight (Monoisotopic): 540.1632AlogP: 2.03#Rotatable Bonds: 8Polar Surface Area: 175.37Molecular Species: NEUTRALHBA: 11HBD: 6#RO5 Violations: 3HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 8.29CX Basic pKa: ┄CX LogP: 3.17CX LogD: 3.11Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.18Np Likeness Score: 1.33
References 1. Park S, Kim YN, Kwak HJ, Jeong EJ, Kim SH.. (2018) Estrogenic activity of constituents from the rhizomes of Rheum undulatum Linné., 28 (4): [PMID:29402747 ] [10.1016/j.bmcl.2018.01.063 ]