6\"-4-hydroxybenzoyl rhaponticin

ID: ALA4218215

PubChem CID: 145970760

Max Phase: Preclinical

Molecular Formula: C28H28O11

Molecular Weight: 540.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(/C=C/c2cc(O)cc(O[C@@H]3O[C@H](COC(=O)c4ccc(O)cc4)[C@@H](O)[C@H](O)[C@H]3O)c2)cc1O

Standard InChI:  InChI=1S/C28H28O11/c1-36-22-9-4-15(12-21(22)31)2-3-16-10-19(30)13-20(11-16)38-28-26(34)25(33)24(32)23(39-28)14-37-27(35)17-5-7-18(29)8-6-17/h2-13,23-26,28-34H,14H2,1H3/b3-2+/t23-,24-,25+,26-,28-/m1/s1

Standard InChI Key:  JSNZZWURTDZGLL-LZRUTRTESA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   15.3179  -10.4894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3179  -12.1595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8895  -12.9779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4527  -12.1596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8894  -10.4978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4573   -9.6619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6016  -10.9132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6016  -11.7398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8894  -12.1512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1732  -11.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1732  -10.9133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4527  -10.4895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3337   -9.2615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1859  -10.4894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8976  -10.9056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0621   -9.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4658  -10.9015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0421  -11.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6219   -9.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0380  -10.9015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7540  -12.1378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6177  -10.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0538  -10.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7498  -10.4894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4699  -11.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3337  -10.9181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7947   -9.2782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7540  -12.9619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7458   -9.2460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7502   -8.4218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0298   -9.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3195   -9.2366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6040   -9.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5991  -10.4691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3156  -10.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0282  -10.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8836  -10.8783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5001   -9.7044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7638  -10.9288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  6 12  1  0
 11  5  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  1
  7  1  1  1
  8  2  1  6
  9  3  1  1
 10  4  1  6
 14 15  2  0
 15 22  1  0
 16 13  1  0
 17 14  1  0
 18 21  1  0
 19 13  2  0
 20 24  1  0
 21 25  2  0
 22 19  1  0
 23 16  2  0
 24 17  2  0
 25 17  1  0
 26 22  2  0
 27 16  1  0
  1 20  1  0
 28 21  1  0
 23 26  1  0
 18 20  2  0
  6 29  1  0
 29 30  2  0
 29 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 34 37  1  0
 27 38  1  0
 23 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4218215

    ---

Associated Targets(Human)

ESR2 Tclin Estrogen receptor (3070 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 540.52Molecular Weight (Monoisotopic): 540.1632AlogP: 2.03#Rotatable Bonds: 8
Polar Surface Area: 175.37Molecular Species: NEUTRALHBA: 11HBD: 6
#RO5 Violations: 3HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 3
CX Acidic pKa: 8.29CX Basic pKa: CX LogP: 3.17CX LogD: 3.11
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.18Np Likeness Score: 1.33

References

1. Park S, Kim YN, Kwak HJ, Jeong EJ, Kim SH..  (2018)  Estrogenic activity of constituents from the rhizomes of Rheum undulatum Linné.,  28  (4): [PMID:29402747] [10.1016/j.bmcl.2018.01.063]

Source