The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 6-(3-(3,4-dichlorophenyl)ureido)-4-oxo-1,4-dihydroquinoline-2-carboxylate ID: ALA4218261
PubChem CID: 145969156
Max Phase: Preclinical
Molecular Formula: C18H13Cl2N3O4
Molecular Weight: 406.23
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1cc(=O)c2cc(NC(=O)Nc3ccc(Cl)c(Cl)c3)ccc2[nH]1
Standard InChI: InChI=1S/C18H13Cl2N3O4/c1-27-17(25)15-8-16(24)11-6-9(3-5-14(11)23-15)21-18(26)22-10-2-4-12(19)13(20)7-10/h2-8H,1H3,(H,23,24)(H2,21,22,26)
Standard InChI Key: SOEGUZXBWDTFJH-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
6.4164 -21.7051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4153 -22.5246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1233 -22.9336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1215 -21.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8302 -21.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8335 -22.5221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5420 -22.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2516 -22.5163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2482 -21.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5352 -21.2860 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5442 -23.7444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9547 -21.2849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9522 -20.4677 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6636 -21.6913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6662 -22.5085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7072 -22.9326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9999 -22.5235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2918 -22.9315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0005 -21.7063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5844 -22.5224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5899 -21.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8833 -21.2951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1743 -21.7032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1763 -22.5246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8834 -22.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4664 -21.2950 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.8843 -20.4779 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
7 11 2 0
9 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
2 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
22 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 406.23Molecular Weight (Monoisotopic): 405.0283AlogP: 4.27#Rotatable Bonds: 3Polar Surface Area: 100.29Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.70CX Basic pKa: ┄CX LogP: 4.31CX LogD: 4.31Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.57Np Likeness Score: -1.18
References 1. Ling T, Lang W, Feng X, Das S, Maier J, Jeffries C, Shelat A, Rivas F.. (2018) Novel vitexin-inspired scaffold against leukemia., 146 [PMID:29407975 ] [10.1016/j.ejmech.2018.01.004 ]