(Z)-6-[(1R,2S)-2-Azepan-1-yl-5-(4'-carbamoylmethyl-biphenyl-4-ylmethoxy)-cyclopentyloxy]-hex-4-enoic acid

ID: ALA421831

PubChem CID: 44374481

Max Phase: Preclinical

Molecular Formula: C32H42N2O5

Molecular Weight: 534.70

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=O)Cc1ccc(-c2ccc(COC3CC[C@H](N4CCCCCC4)[C@H]3OC/C=C\CCC(=O)O)cc2)cc1

Standard InChI:  InChI=1S/C32H42N2O5/c33-30(35)22-24-9-13-26(14-10-24)27-15-11-25(12-16-27)23-39-29-18-17-28(34-19-5-1-2-6-20-34)32(29)38-21-7-3-4-8-31(36)37/h3,7,9-16,28-29,32H,1-2,4-6,8,17-23H2,(H2,33,35)(H,36,37)/b7-3-/t28-,29?,32+/m0/s1

Standard InChI Key:  CEKMCURBOQYMIO-KWDMWAAPSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  1  0  0  0  0  0999 V2000
    1.5875   -3.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4042   -2.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1667   -4.2250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8792   -4.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6917   -0.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5792   -2.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3625   -3.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8292   -1.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0167   -1.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1542   -2.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2542   -3.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2667    0.2125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0167   -3.3542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2292   -0.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6042   -0.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6167   -2.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2417   -1.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4917   -2.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3625   -2.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2875   -1.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1917   -2.6167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5167   -0.4875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4625   -1.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5625   -1.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3875   -1.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2625   -4.3292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0417   -0.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0625   -1.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7875   -0.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8000   -2.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9417   -3.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9000   -5.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8667   -3.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8000   -3.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8625   -3.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6417   -4.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3417   -5.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7417   -5.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1625   -5.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  1
  4  1  1  0
  5 20  1  0
  6  2  1  0
  7 34  1  0
  8  9  1  0
  9 16  1  0
 10  6  1  0
 11  4  1  0
 12  5  2  0
 13  7  2  0
 14  8  1  0
 15 29  1  0
 16 30  2  0
 17  8  2  0
 18 33  1  0
 19 18  2  0
 20 23  1  0
  2 21  1  6
 22  5  1  0
 23 28  2  0
 24 10  1  0
 25 24  1  0
 26  7  1  0
 27 14  2  0
 28 17  1  0
 29 25  2  0
 30 25  1  0
 31  3  1  0
 32  3  1  0
 33 21  1  0
 34 35  1  0
 35 19  1  0
 36 31  1  0
 37 32  1  0
 38 36  1  0
 39 37  1  0
  6 11  1  0
 38 39  1  0
  9 15  2  0
 23 27  1  0
M  END

Associated Targets(Human)

TBXA2R Tclin Thromboxane A2 receptor (5717 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Tbxa2r Thromboxane A2 receptor (199 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 534.70Molecular Weight (Monoisotopic): 534.3094AlogP: 5.11#Rotatable Bonds: 13
Polar Surface Area: 102.09Molecular Species: ZWITTERIONHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.79CX Basic pKa: 10.12CX LogP: 2.13CX LogD: 2.13
Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.35Np Likeness Score: 0.49

References

1. Campbell I, Collington E, Finch H, Hallett P, Hayes R, Lumley P, Mills K, Wallis C, White B.  (1991)  Synthesis and pharmacological evaluation of novel Amino-prostanoids: potent and orally effective thromboxane A2 receptor antagonists,  (12): [10.1016/S0960-894X(01)81049-0]

Source