The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[(1-benzyl-1H-1,2,3-triazol-4-yl)methyl]-N-methyl-3-[6-(4-methylpiperazin-1-yl)pyridin-3-yl]-1H-pyrazolo[3,4-d]pyrimidin-6-amine ID: ALA4218369
PubChem CID: 145969844
Max Phase: Preclinical
Molecular Formula: C26H29N11
Molecular Weight: 495.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNc1ncc2c(-c3ccc(N4CCN(C)CC4)nc3)nn(Cc3cn(Cc4ccccc4)nn3)c2n1
Standard InChI: InChI=1S/C26H29N11/c1-27-26-29-15-22-24(20-8-9-23(28-14-20)35-12-10-34(2)11-13-35)32-37(25(22)30-26)18-21-17-36(33-31-21)16-19-6-4-3-5-7-19/h3-9,14-15,17H,10-13,16,18H2,1-2H3,(H,27,29,30)
Standard InChI Key: CXISENKPXGMZEE-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
24.4111 -16.7070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4100 -17.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1180 -17.9355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1163 -16.2981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8249 -16.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8297 -17.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6097 -17.7704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0871 -17.1053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6019 -16.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8504 -15.6710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6500 -15.4974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8981 -14.7196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3475 -14.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5456 -14.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3013 -15.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5992 -13.3389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3986 -13.1650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6463 -12.3900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0980 -11.7835 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2986 -11.9575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0474 -12.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8667 -18.5462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3235 -19.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5101 -19.0783 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1820 -19.8267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7926 -20.3701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.4978 -19.9573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7020 -17.9346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9946 -17.5254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7119 -21.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9674 -21.5200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3057 -21.0397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5617 -21.3759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4805 -22.1899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1494 -22.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8908 -22.3279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3479 -11.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
9 10 1 0
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
13 16 1 0
7 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 23 2 0
2 28 1 0
28 29 1 0
26 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
19 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.60Molecular Weight (Monoisotopic): 495.2607AlogP: 2.37#Rotatable Bonds: 7Polar Surface Area: 105.71Molecular Species: NEUTRALHBA: 11HBD: 1#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.45CX LogP: 2.96CX LogD: 2.63Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: -2.06
References 1. Myers SH, Temps C, Houston DR, Brunton VG, Unciti-Broceta A.. (2018) Development of Potent Inhibitors of Receptor Tyrosine Kinases by Ligand-Based Drug Design and Target-Biased Phenotypic Screening., 61 (5): [PMID:29466002 ] [10.1021/acs.jmedchem.7b01605 ]