The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-((8,9-dimethoxy-6,11-dihydro-5H-benzo[e]pyrimido[5,4-b][1,4]diazepin-4-yl)oxy)phenyl)-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide ID: ALA4218389
PubChem CID: 145970764
Max Phase: Preclinical
Molecular Formula: C30H27FN6O5
Molecular Weight: 570.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)Nc1ncnc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3)c1NC2
Standard InChI: InChI=1S/C30H27FN6O5/c1-40-23-13-17-15-32-25-26(37-22(17)14-24(23)41-2)33-16-34-27(25)42-21-9-7-20(8-10-21)36-29(39)30(11-12-30)28(38)35-19-5-3-18(31)4-6-19/h3-10,13-14,16,32H,11-12,15H2,1-2H3,(H,35,38)(H,36,39)(H,33,34,37)
Standard InChI Key: QRWMPHFMOUEZFY-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
25.4196 -8.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8323 -8.7745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2407 -8.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1363 -9.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1543 -10.0319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4164 -8.8165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5477 -9.1880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2540 -8.7645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5499 -10.0097 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.7090 -9.2464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7307 -10.0752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0326 -10.4995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3170 -10.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2992 -9.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9932 -8.8690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6111 -10.5424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9516 -12.7960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6914 -12.4217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8645 -11.6297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3369 -10.9769 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5143 -11.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0105 -11.6517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2041 -12.4520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0692 -12.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2938 -12.9703 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6293 -11.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2420 -11.9292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6099 -13.0197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8221 -12.7871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6257 -11.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2199 -11.4221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2587 -10.4164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2557 -11.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9636 -11.6379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6712 -11.2273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6664 -10.4059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9578 -10.0030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3805 -11.6331 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.8411 -11.7613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2509 -12.3266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2312 -13.3516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4469 -13.1221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
4 5 2 0
4 6 1 0
2 4 1 0
7 8 2 0
7 9 1 0
2 7 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
17 23 1 0
24 25 1 0
26 27 1 0
24 27 2 0
18 25 2 0
19 26 2 0
28 29 1 0
29 30 2 0
30 31 1 0
22 31 2 0
23 28 2 0
16 26 1 0
13 16 1 0
6 10 1 0
9 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
35 38 1 0
30 39 1 0
39 40 1 0
29 41 1 0
41 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 570.58Molecular Weight (Monoisotopic): 570.2027AlogP: 5.45#Rotatable Bonds: 8Polar Surface Area: 135.73Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 3CX Acidic pKa: 13.09CX Basic pKa: 3.86CX LogP: 4.43CX LogD: 4.43Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.20Np Likeness Score: -0.66
References 1. Huang D, Huang L, Zhang Q, Li J.. (2017) Synthesis and biological evaluation of novel 6,11-dihydro-5H-benzo[e]pyrimido- [5,4-b][1,4]diazepine derivatives as potential c-Met inhibitors., 140 [PMID:28938137 ] [10.1016/j.ejmech.2017.08.060 ]