The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Methyl-1-(2-(4-(ethylsulfonyl)piperazin-1-yl)ethyl)-5-((4-((6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl)amino)piperidin-1-yl)methyl)-1H-indole-2-carbonitrile ID: ALA4218711
PubChem CID: 117636548
Max Phase: Preclinical
Molecular Formula: C32H39F3N8O2S2
Molecular Weight: 688.85
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCS(=O)(=O)N1CCN(CCn2c(C#N)cc3c(C)c(CN4CCC(Nc5ncnc6sc(CC(F)(F)F)cc56)CC4)ccc32)CC1
Standard InChI: InChI=1S/C32H39F3N8O2S2/c1-3-47(44,45)42-13-10-40(11-14-42)12-15-43-25(19-36)16-27-22(2)23(4-5-29(27)43)20-41-8-6-24(7-9-41)39-30-28-17-26(18-32(33,34)35)46-31(28)38-21-37-30/h4-5,16-17,21,24H,3,6-15,18,20H2,1-2H3,(H,37,38,39)
Standard InChI Key: WFSSSQNIEOXNLR-UHFFFAOYSA-N
Molfile:
RDKit 2D
47 52 0 0 0 0 0 0 0 0999 V2000
16.2902 -2.1544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1156 -2.1544 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.7029 -1.4467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9617 -4.4491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9606 -5.2728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6727 -5.6859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6709 -4.0403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3754 -4.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3761 -5.2683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1685 -5.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6500 -4.8516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1608 -4.1881 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.4713 -4.8468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8799 -4.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7012 -4.1277 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.4630 -3.4231 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.2802 -3.4173 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.6738 -6.5072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3779 -6.9149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3776 -7.7352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0859 -8.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7996 -7.7368 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8005 -6.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0877 -6.5024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5104 -8.1513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2232 -7.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9317 -8.1575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9307 -6.5148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2213 -6.9233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9277 -8.9788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6465 -6.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6445 -7.7452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4240 -8.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9054 -7.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4273 -6.6749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7264 -7.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5477 -7.3398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4222 -5.8524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1315 -5.4353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1264 -4.6140 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8311 -4.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8280 -3.3890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1195 -2.9768 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4085 -3.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4100 -4.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8242 -1.7452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8242 -0.9239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
11 13 1 0
13 14 1 0
14 15 1 0
14 16 1 0
14 17 1 0
6 18 1 0
18 19 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 1 0
26 27 2 0
27 32 1 0
31 28 1 0
28 29 2 0
29 26 1 0
27 30 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 31 1 0
36 37 3 0
34 36 1 0
35 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
40 45 1 0
41 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
43 2 1 0
2 46 1 0
46 47 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 688.85Molecular Weight (Monoisotopic): 688.2589AlogP: 4.97#Rotatable Bonds: 10Polar Surface Area: 110.39Molecular Species: BASEHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.75CX LogP: 4.10CX LogD: 2.69Aromatic Rings: 4Heavy Atoms: 47QED Weighted: 0.25Np Likeness Score: -1.87
References 1. Borkin D, Klossowski S, Pollock J, Miao H, Linhares BM, Kempinska K, Jin Z, Purohit T, Wen B, He M, Sun D, Cierpicki T, Grembecka J.. (2018) Complexity of Blocking Bivalent Protein-Protein Interactions: Development of a Highly Potent Inhibitor of the Menin-Mixed-Lineage Leukemia Interaction., 61 (11): [PMID:29738674 ] [10.1021/acs.jmedchem.8b00071 ]