The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-3-(6-(2,6-dichlorostyryl)-2H-spiro[benzofuran-3,4'-piperidine]-1'-yl)propanoic acid hydrochloride ID: ALA4218826
PubChem CID: 66655655
Max Phase: Preclinical
Molecular Formula: C23H24Cl3NO3
Molecular Weight: 432.35
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cl.O=C(O)CCN1CCC2(CC1)COc1cc(/C=C/c3c(Cl)cccc3Cl)ccc12
Standard InChI: InChI=1S/C23H23Cl2NO3.ClH/c24-19-2-1-3-20(25)17(19)6-4-16-5-7-18-21(14-16)29-15-23(18)9-12-26(13-10-23)11-8-22(27)28;/h1-7,14H,8-13,15H2,(H,27,28);1H/b6-4+;
Standard InChI Key: JBIYFAVZTBQJSB-CVDVRWGVSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
11.0876 -21.7991 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.2414 -20.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0160 -20.3817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1854 -19.5765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5756 -19.0319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7888 -19.2902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6237 -20.0841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0286 -20.9068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0298 -21.7235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7547 -22.1382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7430 -20.4903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4595 -20.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4630 -21.7176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2429 -21.9758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7256 -21.3068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7553 -18.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5390 -17.9731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7231 -17.1670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5109 -16.9179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1112 -16.6103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3079 -22.1353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2994 -22.9651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5864 -23.3784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8733 -22.9689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1525 -23.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1509 -24.2014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8686 -24.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5862 -24.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3094 -24.6340 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.8727 -22.1419 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
2 7 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
8 9 2 0
9 10 1 0
10 13 2 0
12 11 2 0
11 8 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 2 1 0
2 12 1 0
5 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
9 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
28 29 1 0
24 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.35Molecular Weight (Monoisotopic): 431.1055AlogP: 5.36#Rotatable Bonds: 5Polar Surface Area: 49.77Molecular Species: ZWITTERIONHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.32CX Basic pKa: 9.42CX LogP: 2.37CX LogD: 2.37Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.65Np Likeness Score: -0.07
References 1. Stoit AR, Lange JHM, Coolen HKAC, Rensink A, van den Hoogenband A, den Hartog AP, van Schaik S, Kruse CG.. (2018) Spiro-1-benzofuranpiperidinylalkanoic acids as a novel and selective sphingosine S1P5 receptor agonist chemotype., 28 (3): [PMID:29254642 ] [10.1016/j.bmcl.2017.12.018 ]