The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-2-Amino-3-cyano-4-p-nitrophenyl-6-(2-pyridyl)-5-phenylsulfinyl-4H-pyran ID: ALA4218932
PubChem CID: 145967803
Max Phase: Preclinical
Molecular Formula: C23H16N4O4S
Molecular Weight: 444.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#CC1=C(N)OC(c2ccccn2)=C([S+]([O-])c2ccccc2)C1c1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C23H16N4O4S/c24-14-18-20(15-9-11-16(12-10-15)27(28)29)22(32(30)17-6-2-1-3-7-17)21(31-23(18)25)19-8-4-5-13-26-19/h1-13,20H,25H2
Standard InChI Key: JVMPAJWNHNSYPQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
19.7715 -13.0220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7715 -13.8470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4841 -14.2533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1967 -13.8470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1967 -13.0220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4841 -12.6033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0552 -12.6096 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.3414 -13.0262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4841 -11.7783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2012 -11.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2015 -10.5450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4859 -10.1296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7686 -10.5486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7717 -11.3715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9097 -12.6087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6218 -12.2004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6256 -12.6106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9165 -13.0265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9185 -13.8524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6355 -14.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3460 -13.8464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9111 -14.2585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0527 -11.7846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3527 -14.5601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5263 -14.5528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1117 -15.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5185 -15.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3481 -15.9815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7630 -15.2728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4853 -9.3031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7697 -8.8936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1998 -8.8918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
1 7 1 0
7 8 1 0
6 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 3 0
5 15 1 0
8 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 8 1 0
4 22 1 0
7 23 1 0
2 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
30 31 2 0
30 32 1 0
12 30 1 0
M CHG 4 7 1 23 -1 30 1 32 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.47Molecular Weight (Monoisotopic): 444.0892AlogP: 3.97#Rotatable Bonds: 5Polar Surface Area: 138.13Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.82CX LogP: 2.67CX LogD: 2.67Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -1.05
References 1. Recio R, Vengut-Climent E, Mouillac B, Orcel H, López-Lázaro M, Calderón-Montaño JM, Álvarez E, Khiar N, Fernández I.. (2017) Design, synthesis and biological studies of a library of NK1-Receptor Ligands Based on a 5-arylthiosubstituted 2-amino-4,6-diaryl-3-cyano-4H-pyran core: Switch from antagonist to agonist effect by chemical modification., 138 [PMID:28710964 ] [10.1016/j.ejmech.2017.06.056 ]