1-[2-(2-Hydroxy-3-morpholin-4-yl-propoxy)-phenyl]-3-naphthalen-1-yl-propan-1-one

ID: ALA422315

PubChem CID: 11304687

Max Phase: Preclinical

Molecular Formula: C26H29NO4

Molecular Weight: 419.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCc1cccc2ccccc12)c1ccccc1OCC(O)CN1CCOCC1

Standard InChI:  InChI=1S/C26H29NO4/c28-22(18-27-14-16-30-17-15-27)19-31-26-11-4-3-10-24(26)25(29)13-12-21-8-5-7-20-6-1-2-9-23(20)21/h1-11,22,28H,12-19H2

Standard InChI Key:  ZXPWSOLCSBLNQC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    3.7042   -0.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4250   -0.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2792    0.7375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7042    0.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8542   -3.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4167    0.7250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1417   -2.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4250   -1.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1375   -0.5167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1417   -2.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5667    0.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7042    1.5583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8625   -4.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8500    0.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1375    0.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8417    1.5583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9917   -0.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9917    0.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2667    1.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4292   -4.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4292   -3.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5625   -2.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9917    1.9708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7042    0.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1417   -4.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9917    0.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5750   -4.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2792   -0.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2750   -3.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2792    0.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2792   -4.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3 11  1  0
  4  1  1  0
  5  7  1  0
  6  4  1  0
  7 10  1  0
  8  2  1  0
  9  2  2  0
 10  8  1  0
 11 14  1  0
 12 23  1  0
 13  5  1  0
 14 15  1  0
 15  6  1  0
 16 14  1  0
 17  1  2  0
 18  3  1  0
 19  3  1  0
 20 21  1  0
 21  7  2  0
 22  5  2  0
 23 19  1  0
 24 18  1  0
 25 20  2  0
 26  4  2  0
 27 13  2  0
 28 17  1  0
 29 22  1  0
 30 28  2  0
 31 29  2  0
 30 26  1  0
 25 13  1  0
 12 24  1  0
 31 27  1  0
M  END

Associated Targets(Human)

CCRF-CEM/VCR-1000 (82 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ABCB1 Tchem P-glycoprotein 1 (14716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.52Molecular Weight (Monoisotopic): 419.2097AlogP: 3.73#Rotatable Bonds: 9
Polar Surface Area: 59.00Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.83CX LogP: 3.81CX LogD: 3.80
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.54Np Likeness Score: -0.86

References

1. Fleischer R, Wiese M..  (2003)  Three-dimensional quantitative structure-activity relationship analysis of propafenone-type multidrug resistance modulators: influence of variable selection on test set predictivity.,  46  (23): [PMID:14584949] [10.1021/jm030876r]
2. Kaiser D, Terfloth L, Kopp S, Schulz J, de Laet R, Chiba P, Ecker GF, Gasteiger J..  (2007)  Self-organizing maps for identification of new inhibitors of P-glycoprotein.,  50  (7): [PMID:17352460] [10.1021/jm060604z]

Source