2-((3S,4S,6S)-4-((S)-1-(benzyloxy)-3-(1H-indol-3-yl)-1-oxopropan-2-ylcarbamoyloxy)-1-oxaspiro[2.5]octan-6-yl)propan-2-yl hex-5-ynoate

ID: ALA4224885

PubChem CID: 101771835

Max Phase: Preclinical

Molecular Formula: C35H40N2O7

Molecular Weight: 600.71

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C#CCCCC(=O)OC(C)(C)[C@H]1CC[C@]2(CO2)[C@@H](OC(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)OCc2ccccc2)C1

Standard InChI:  InChI=1S/C35H40N2O7/c1-4-5-7-16-31(38)44-34(2,3)26-17-18-35(23-42-35)30(20-26)43-33(40)37-29(32(39)41-22-24-12-8-6-9-13-24)19-25-21-36-28-15-11-10-14-27(25)28/h1,6,8-15,21,26,29-30,36H,5,7,16-20,22-23H2,2-3H3,(H,37,40)/t26-,29-,30-,35-/m0/s1

Standard InChI Key:  OUZLIMFGHKWCDE-ODSVIUALSA-N

Molfile:  

     RDKit          2D

 44 48  0  0  0  0  0  0  0  0999 V2000
    6.8040   -3.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3974   -3.1531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9863   -3.8599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9489   -1.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5381   -1.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3636   -1.9120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1152   -1.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1152   -2.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8283   -3.1490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5414   -2.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8283   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2571   -3.1527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6882   -2.7445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9732   -3.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2571   -2.7465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9744   -3.9818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5421   -3.1582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8260   -2.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1111   -3.1603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3972   -3.5795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2575   -3.9784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9733   -4.3928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5422   -4.3935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9737   -5.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6894   -5.6288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6898   -6.4544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4048   -5.2178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1164   -5.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8317   -5.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5454   -5.6290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2604   -5.2186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2604   -4.3921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5396   -3.9778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8277   -4.3946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2583   -5.6295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2588   -6.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6751   -7.7288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9326   -6.9434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8495   -7.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5969   -6.9443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7920   -6.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2427   -7.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5000   -8.1701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3044   -8.3369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  5  6  1  1
  4  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10  5  1  0
  5 11  1  0
 10 12  1  1
  8  2  1  1
  2 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  3  0
 12 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  1  0
 24 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 24 35  1  6
 35 36  1  0
 36 40  1  0
 39 37  1  0
 37 38  1  0
 38 36  2  0
 39 40  2  0
 40 41  1  0
 41 42  2  0
 42 43  1  0
 43 44  2  0
 44 39  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4224885

   2-[(3S,4S,6S)-4-[[(2S)-3-(1H-indol-3-yl)-1-oxo-1-phenylmethoxypropan-2-yl]carbamoyloxy]-1-oxaspiro[2.5]octan-6-yl]propan-2-yl hex-5-ynoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 600.71

Molecular Weight (Monoisotopic): 600.2836

AlogP: 5.61

#Rotatable Bonds: 12

Polar Surface Area: 119.25

Molecular Species: NEUTRAL

HBA: 7

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 9

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 13.35

CX Basic pKa: ┄

CX LogP: 5.90

CX LogD: 5.90

Aromatic Rings: 3

Heavy Atoms: 44

QED Weighted: 0.09

Np Likeness Score: 0.51

References

1. Wang P, Jiang L, Cao Y, Zhang X, Chen B, Zhang S, Huang K, Ye D, Zhou L..  (2018)  Xanthone derivatives as phosphoglycerate mutase 1 inhibitors: Design, synthesis, and biological evaluation.,  26  (8): [PMID:29530347] [10.1016/j.bmc.2018.02.044]

2. Jiang K,Gao B,Yu J,Jiang L,Niu A,Jia Y,Meng T,Zhou L,Wang J.  (2021)  Design, synthesis, and biological evaluation of 1,3,6,7-tetrahydroxyxanthone derivatives as phosphoglycerate mutase 1 inhibitors.,  36  [PMID:33513389] [10.1016/j.bmcl.2021.127820]

Source

Source(1):

• Scientific Literature