The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-(4-cyano-2,6-dimethylphenoxy)-2-(4-cyanophenylamino)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)methyl isopropyl carbonate ID: ALA4225783
PubChem CID: 134816819
Max Phase: Preclinical
Molecular Formula: C27H24N6O4
Molecular Weight: 496.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C#N)cc(C)c1Oc1nc(Nc2ccc(C#N)cc2)nc2c1ccn2COC(=O)OC(C)C
Standard InChI: InChI=1S/C27H24N6O4/c1-16(2)36-27(34)35-15-33-10-9-22-24(33)31-26(30-21-7-5-19(13-28)6-8-21)32-25(22)37-23-17(3)11-20(14-29)12-18(23)4/h5-12,16H,15H2,1-4H3,(H,30,31,32)
Standard InChI Key: IWSGUOFMIJYMTD-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
4.0556 -5.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0545 -6.2014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7625 -6.6104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4722 -6.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4694 -5.3783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7608 -4.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3465 -6.6094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1806 -6.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7623 -7.4276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7541 -4.1600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7517 -3.3428 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4700 -7.8363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8812 -8.6520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8788 -7.8305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1714 -7.4255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1724 -9.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4662 -8.6534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8608 -9.1992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 -9.9437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0034 -9.8578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5851 -7.4196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5824 -6.6024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2889 -6.1955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2866 -5.3791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5770 -4.9720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8683 -5.3873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8741 -6.2023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5702 -4.1590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5664 -3.3419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5507 -10.4647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3499 -10.2942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8972 -10.9011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6964 -10.7306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6452 -11.6785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2436 -11.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0428 -11.1670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9917 -12.1149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
4 8 1 0
3 9 1 0
10 11 3 0
6 10 1 0
9 12 1 0
12 17 2 0
16 13 2 0
13 14 1 0
14 15 2 0
15 12 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 1 0
14 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
28 29 3 0
25 28 1 0
20 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
35 36 1 0
35 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.53Molecular Weight (Monoisotopic): 496.1859AlogP: 5.85#Rotatable Bonds: 7Polar Surface Area: 135.08Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.16CX Basic pKa: 4.00CX LogP: 6.95CX LogD: 6.95Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: -1.01
References 1. Huang B, Liu X, Tian Y, Kang D, Zhou Z, Daelemans D, De Clercq E, Pannecouque C, Zhan P, Liu X.. (2018) First discovery of a potential carbonate prodrug of NNRTI drug candidate RDEA427 with submicromolar inhibitory activity against HIV-1 K103N/Y181C double mutant strain., 28 (8): [PMID:29534929 ] [10.1016/j.bmcl.2018.03.012 ]