The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-fluoro-3-(2-(5-methylisoindolin-2-yl)-2-oxoethyl)phenyl)-N-(1H-indazol-5-yl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide ID: ALA4225917
PubChem CID: 145970840
Max Phase: Preclinical
Molecular Formula: C30H27FN6O3
Molecular Weight: 538.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)Nc2ccc3[nH]ncc3c2)C(c2ccc(F)c(CC(=O)N3Cc4ccc(C)cc4C3)c2)NC(=O)N1
Standard InChI: InChI=1S/C30H27FN6O3/c1-16-3-4-19-14-37(15-22(19)9-16)26(38)12-20-10-18(5-7-24(20)31)28-27(17(2)33-30(40)35-28)29(39)34-23-6-8-25-21(11-23)13-32-36-25/h3-11,13,28H,12,14-15H2,1-2H3,(H,32,36)(H,34,39)(H2,33,35,40)
Standard InChI Key: DFVNXKBWZZASCC-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
4.0996 -10.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8161 -9.9183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8133 -9.0879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0978 -8.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3849 -9.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3861 -9.0899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5982 -8.8326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1098 -9.5025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5961 -10.1737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5261 -8.6727 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2422 -9.0824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9550 -8.6673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2452 -9.9074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6697 -9.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3804 -8.6681 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3816 -7.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6657 -7.4308 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9487 -7.8441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2338 -7.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2322 -6.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5171 -6.1992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8032 -6.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8087 -7.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5244 -7.8497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6703 -9.9048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0961 -7.4303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0867 -6.2052 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.5147 -5.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7990 -4.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7964 -4.1389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0857 -5.3785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4672 -3.6521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1325 -3.6562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3848 -2.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2105 -2.8683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6195 -2.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2039 -1.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3750 -1.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9698 -2.1622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6121 -0.7230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
3 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 2 0
12 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
18 19 1 0
14 25 1 0
16 26 2 0
22 27 1 0
21 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
32 35 1 0
34 33 1 0
33 30 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
37 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.58Molecular Weight (Monoisotopic): 538.2129AlogP: 4.36#Rotatable Bonds: 5Polar Surface Area: 119.22Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.03CX Basic pKa: 1.71CX LogP: 2.67CX LogD: 2.67Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.30Np Likeness Score: -1.70
References 1. Waldschmidt HV, Bouley R, Kirchhoff PD, Lee P, Tesmer JJG, Larsen SD.. (2018) Utilizing a structure-based docking approach to develop potent G protein-coupled receptor kinase (GRK) 2 and 5 inhibitors., 28 (9): [PMID:29627263 ] [10.1016/j.bmcl.2018.03.082 ]