The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4,7-Diphenyl-N-propyl-5-(trifluoromethyl)pyrido[2,3-d]pyrimidine-2-carboxamide ID: ALA4226617
PubChem CID: 145970178
Max Phase: Preclinical
Molecular Formula: C24H19F3N4O
Molecular Weight: 436.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCNC(=O)c1nc(-c2ccccc2)c2c(C(F)(F)F)cc(-c3ccccc3)nc2n1
Standard InChI: InChI=1S/C24H19F3N4O/c1-2-13-28-23(32)22-30-20(16-11-7-4-8-12-16)19-17(24(25,26)27)14-18(29-21(19)31-22)15-9-5-3-6-10-15/h3-12,14H,2,13H2,1H3,(H,28,32)
Standard InChI Key: GTADZFASWCYOEM-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
21.4011 -3.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1077 -3.4122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8102 -3.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8102 -2.1905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1077 -1.7861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4011 -2.1905 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5126 -1.7861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2192 -2.1905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2192 -3.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5126 -3.4122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6986 -3.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9920 -3.0036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6986 -4.2253 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9920 -4.6297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9920 -5.4428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2895 -5.8514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9217 -3.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6283 -3.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3308 -3.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3308 -4.2253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6283 -4.6297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9217 -4.2253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1077 -0.7254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4011 -0.3209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4011 0.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1077 0.9070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8102 0.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8102 -0.3209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5116 -0.9689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2188 -0.5594 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.8034 -0.5612 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.5046 -0.1486 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
7 8 2 0
8 9 1 0
9 10 2 0
3 10 1 0
4 7 1 0
11 12 2 0
11 13 1 0
1 11 1 0
14 15 1 0
15 16 1 0
13 14 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
9 17 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
23 28 2 0
5 23 1 0
7 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.44Molecular Weight (Monoisotopic): 436.1511AlogP: 5.52#Rotatable Bonds: 5Polar Surface Area: 67.77Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.32CX Basic pKa: ┄CX LogP: 6.11CX LogD: 6.11Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.45Np Likeness Score: -1.16
References 1. Veeraswamy B, Madhu D, Jitender Dev G, Poornachandra Y, Shravan Kumar G, Ganesh Kumar C, Narsaiah B.. (2018) Studies on synthesis of novel pyrido[2,3-d]pyrimidine derivatives, evaluation of their antimicrobial activity and molecular docking., 28 (9): [PMID:29602683 ] [10.1016/j.bmcl.2018.03.022 ]