The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,4-Difluoro-N-(2-methoxy-5-(4-((pyridin-4-ylmethyl)amino)quinazolin-6-yl)pyridin-3-yl)benzenesulfonamide ID: ALA4226989
PubChem CID: 145970404
Max Phase: Preclinical
Molecular Formula: C26H20F2N6O3S
Molecular Weight: 534.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ncc(-c2ccc3ncnc(NCc4ccncc4)c3c2)cc1NS(=O)(=O)c1ccc(F)cc1F
Standard InChI: InChI=1S/C26H20F2N6O3S/c1-37-26-23(34-38(35,36)24-5-3-19(27)12-21(24)28)11-18(14-31-26)17-2-4-22-20(10-17)25(33-15-32-22)30-13-16-6-8-29-9-7-16/h2-12,14-15,34H,13H2,1H3,(H,30,32,33)
Standard InChI Key: UHRZATOVFSVNGL-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
37.3482 -20.4334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.7641 -21.1488 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.1757 -20.4309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0561 -21.5668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3359 -21.1580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6211 -21.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6240 -22.4020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3503 -22.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0632 -22.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4857 -21.5639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2053 -20.3140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2058 -21.1410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9201 -21.5539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6337 -21.1439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6332 -20.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9190 -19.9040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.4822 -22.7915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.1959 -22.3773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1977 -21.5540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.4793 -21.1410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7675 -21.5556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0574 -21.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3438 -21.5527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3443 -22.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0585 -22.7884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7681 -22.3785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4788 -20.3181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.1925 -19.9082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4754 -17.8408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4759 -18.6678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1901 -19.0807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9038 -18.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9033 -17.8396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1932 -17.4266 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.4869 -19.8928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9009 -22.8256 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.3287 -20.3374 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.4925 -19.0693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
4 9 2 0
2 10 1 0
4 2 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
17 26 2 0
21 26 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
29 34 2 0
28 31 1 0
27 28 1 0
20 27 1 0
14 23 1 0
11 35 1 0
10 12 1 0
7 36 1 0
5 37 1 0
35 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.55Molecular Weight (Monoisotopic): 534.1286AlogP: 4.79#Rotatable Bonds: 8Polar Surface Area: 118.99Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.60CX Basic pKa: 5.19CX LogP: 3.49CX LogD: 3.00Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.29Np Likeness Score: -1.72
References 1. Fan YH, Ding HW, Liu DD, Song HR, Xu YN, Wang J.. (2018) Novel 4-aminoquinazoline derivatives induce growth inhibition, cell cycle arrest and apoptosis via PI3Kα inhibition., 26 (8): [PMID:29475582 ] [10.1016/j.bmc.2018.02.015 ]