The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(pyrrolidin-1-yl)-N-(1,2,8-trihydroxy-9-oxo-9H-xanthen-3-yl)benzenesulfonamide ID: ALA4227083
PubChem CID: 145970892
Max Phase: Preclinical
Molecular Formula: C23H20N2O7S
Molecular Weight: 468.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=c1c2c(O)cccc2oc2cc(NS(=O)(=O)c3ccc(N4CCCC4)cc3)c(O)c(O)c12
Standard InChI: InChI=1S/C23H20N2O7S/c26-16-4-3-5-17-19(16)22(28)20-18(32-17)12-15(21(27)23(20)29)24-33(30,31)14-8-6-13(7-9-14)25-10-1-2-11-25/h3-9,12,24,26-27,29H,1-2,10-11H2
Standard InChI Key: GDCWTQZIYLQMCS-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
17.2972 -21.0447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7099 -21.7546 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.1184 -21.0423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0377 -20.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0366 -21.7569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7446 -22.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7428 -20.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4514 -20.9338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4503 -21.7590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1604 -22.1703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1627 -20.5199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8774 -20.9358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8761 -21.7569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5854 -22.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2965 -21.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2938 -20.9325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5839 -20.5263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1628 -19.7027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5816 -19.7091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0000 -20.5213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0048 -22.1643 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4202 -22.1623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7404 -19.7113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4191 -22.9791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1285 -23.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8377 -22.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8329 -22.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1230 -21.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5472 -23.3793 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6358 -24.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4358 -24.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8417 -23.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2924 -23.0441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 11 1 0
9 10 1 0
10 13 1 0
12 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
11 18 2 0
17 19 1 0
16 20 1 0
15 21 1 0
21 2 1 0
2 22 1 0
7 23 1 0
22 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 22 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 29 1 0
26 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.49Molecular Weight (Monoisotopic): 468.0991AlogP: 3.46#Rotatable Bonds: 4Polar Surface Area: 140.31Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.05CX Basic pKa: 2.53CX LogP: 5.00CX LogD: 4.49Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.26Np Likeness Score: -0.27
References 1. Wang P, Jiang L, Cao Y, Zhang X, Chen B, Zhang S, Huang K, Ye D, Zhou L.. (2018) Xanthone derivatives as phosphoglycerate mutase 1 inhibitors: Design, synthesis, and biological evaluation., 26 (8): [PMID:29530347 ] [10.1016/j.bmc.2018.02.044 ]