The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1,2,8-trihydroxy-9-oxo-9H-xanthen-3-yl)naphthalene-1-sulfonamide ID: ALA4227402
PubChem CID: 145968862
Max Phase: Preclinical
Molecular Formula: C23H15NO7S
Molecular Weight: 449.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=c1c2c(O)cccc2oc2cc(NS(=O)(=O)c3cccc4ccccc34)c(O)c(O)c12
Standard InChI: InChI=1S/C23H15NO7S/c25-15-8-4-9-16-19(15)22(27)20-17(31-16)11-14(21(26)23(20)28)24-32(29,30)18-10-3-6-12-5-1-2-7-13(12)18/h1-11,24-26,28H
Standard InChI Key: UIQSDCZBQNDLLV-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
7.0369 -16.9959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4496 -17.7058 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.8581 -16.9934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7774 -16.8886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7763 -17.7081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4843 -18.1171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4825 -16.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1911 -16.8850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1900 -17.7102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9001 -18.1215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9024 -16.4711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6171 -16.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6158 -17.7081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3251 -18.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0362 -17.7079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0335 -16.8836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3236 -16.4775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9025 -15.6539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3213 -15.6603 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7397 -16.4725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7445 -18.1155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1599 -18.1135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4801 -15.6625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1588 -18.9303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8682 -19.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5774 -18.9265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8627 -17.6995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5699 -18.1019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2698 -17.6907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2638 -16.8773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5519 -16.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8549 -16.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 11 1 0
9 10 1 0
10 13 1 0
12 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
11 18 2 0
17 19 1 0
16 20 1 0
15 21 1 0
21 2 1 0
2 22 1 0
7 23 1 0
22 24 2 0
24 25 1 0
25 26 2 0
26 28 1 0
27 22 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 27 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.44Molecular Weight (Monoisotopic): 449.0569AlogP: 4.02#Rotatable Bonds: 3Polar Surface Area: 137.07Molecular Species: ACIDHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.46CX Basic pKa: ┄CX LogP: 5.48CX LogD: 4.66Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.24Np Likeness Score: 0.04
References 1. Wang P, Jiang L, Cao Y, Zhang X, Chen B, Zhang S, Huang K, Ye D, Zhou L.. (2018) Xanthone derivatives as phosphoglycerate mutase 1 inhibitors: Design, synthesis, and biological evaluation., 26 (8): [PMID:29530347 ] [10.1016/j.bmc.2018.02.044 ]