The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1,2,8-trihydroxy-9-oxo-9H-xanthen-3-yl)-[1,1'-biphenyl]-4-sulfonamide ID: ALA4227876
PubChem CID: 145971164
Max Phase: Preclinical
Molecular Formula: C25H17NO7S
Molecular Weight: 475.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=c1c2c(O)cccc2oc2cc(NS(=O)(=O)c3ccc(-c4ccccc4)cc3)c(O)c(O)c12
Standard InChI: InChI=1S/C25H17NO7S/c27-18-7-4-8-19-21(18)24(29)22-20(33-19)13-17(23(28)25(22)30)26-34(31,32)16-11-9-15(10-12-16)14-5-2-1-3-6-14/h1-13,26-28,30H
Standard InChI Key: QROVKHNSSZVWOW-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
29.1795 -17.4128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5922 -18.1227 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.0006 -17.4103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9200 -17.3054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9189 -18.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6269 -18.5339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6251 -16.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3337 -17.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3325 -18.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0426 -18.5384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0450 -16.8880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7597 -17.3039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7584 -18.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4677 -18.5348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1788 -18.1247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1761 -17.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4662 -16.8944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0451 -16.0708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4639 -16.0772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8823 -16.8894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8870 -18.5323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3025 -18.5303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6227 -16.0794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3014 -19.3471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0108 -19.7547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7200 -19.3434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7152 -18.5202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0053 -18.1164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4262 -19.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4280 -20.5671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1365 -20.9728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8436 -20.5614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8378 -19.7400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1288 -19.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 11 1 0
9 10 1 0
10 13 1 0
12 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
11 18 2 0
17 19 1 0
16 20 1 0
15 21 1 0
21 2 1 0
2 22 1 0
7 23 1 0
22 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 22 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
26 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.48Molecular Weight (Monoisotopic): 475.0726AlogP: 4.53#Rotatable Bonds: 4Polar Surface Area: 137.07Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.68CX Basic pKa: ┄CX LogP: 6.13CX LogD: 5.42Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.22Np Likeness Score: 0.04
References 1. Wang P, Jiang L, Cao Y, Zhang X, Chen B, Zhang S, Huang K, Ye D, Zhou L.. (2018) Xanthone derivatives as phosphoglycerate mutase 1 inhibitors: Design, synthesis, and biological evaluation., 26 (8): [PMID:29530347 ] [10.1016/j.bmc.2018.02.044 ]