The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1H-Indol-5-yl)-3-(4-phenoxybenzamido)benzamide ID: ALA4228325
PubChem CID: 145971184
Max Phase: Preclinical
Molecular Formula: C28H21N3O3
Molecular Weight: 447.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cccc(C(=O)Nc2ccc3[nH]ccc3c2)c1)c1ccc(Oc2ccccc2)cc1
Standard InChI: InChI=1S/C28H21N3O3/c32-27(19-9-12-25(13-10-19)34-24-7-2-1-3-8-24)30-22-6-4-5-21(18-22)28(33)31-23-11-14-26-20(17-23)15-16-29-26/h1-18,29H,(H,30,32)(H,31,33)
Standard InChI Key: FXSGNHLLJPQQTA-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
22.5374 -11.2178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5362 -12.0373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2443 -12.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9539 -12.0368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9511 -11.2142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2425 -10.8089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6588 -10.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3681 -11.2086 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6557 -9.9855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0742 -10.7973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7813 -11.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7702 -9.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0674 -9.9866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4844 -9.9795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4877 -10.7933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2628 -11.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7385 -10.3812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2574 -9.7249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8296 -10.8093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1220 -11.2181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1222 -12.0353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4165 -10.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4176 -9.9919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7106 -9.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0020 -9.9924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0049 -10.8138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7124 -11.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2937 -9.5849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5866 -9.9946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8812 -9.5850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1746 -9.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1754 -10.8121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8888 -11.2194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5924 -10.8081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
7 9 2 0
5 7 1 0
8 10 1 0
10 11 2 0
11 15 1 0
14 12 1 0
12 13 2 0
13 10 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 14 1 0
1 19 1 0
19 20 1 0
20 21 2 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
20 22 1 0
25 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.49Molecular Weight (Monoisotopic): 447.1583AlogP: 6.46#Rotatable Bonds: 6Polar Surface Area: 83.22Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.76CX LogD: 5.76Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.28Np Likeness Score: -1.00
References 1. Wang PF, Zhang YJ, Wang D, Hu HM, Wang ZC, Xu C, Qiu HY, Zhu HL.. (2018) Design, synthesis, and biological evaluation of new B-RafV600E kinase inhibitors., 26 (9): [PMID:29602674 ] [10.1016/j.bmc.2018.03.038 ]