N-(1H-Indol-5-yl)-3-(4-phenoxybenzamido)benzamide

ID: ALA4228325

PubChem CID: 145971184

Max Phase: Preclinical

Molecular Formula: C28H21N3O3

Molecular Weight: 447.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1cccc(C(=O)Nc2ccc3[nH]ccc3c2)c1)c1ccc(Oc2ccccc2)cc1

Standard InChI:  InChI=1S/C28H21N3O3/c32-27(19-9-12-25(13-10-19)34-24-7-2-1-3-8-24)30-22-6-4-5-21(18-22)28(33)31-23-11-14-26-20(17-23)15-16-29-26/h1-18,29H,(H,30,32)(H,31,33)

Standard InChI Key:  FXSGNHLLJPQQTA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   22.5374  -11.2178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5362  -12.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2443  -12.4463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9539  -12.0368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9511  -11.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2425  -10.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6588  -10.8027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3681  -11.2086    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.6557   -9.9855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0742  -10.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7813  -11.2081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7702   -9.5737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0674   -9.9866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4844   -9.9795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4877  -10.7933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2628  -11.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7385  -10.3812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2574   -9.7249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8296  -10.8093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1220  -11.2181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1222  -12.0353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4165  -10.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4176   -9.9919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7106   -9.5835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0020   -9.9924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0049  -10.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7124  -11.2184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2937   -9.5849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5866   -9.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8812   -9.5850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1746   -9.9941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1754  -10.8121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8888  -11.2194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5924  -10.8081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  7  9  2  0
  5  7  1  0
  8 10  1  0
 10 11  2  0
 11 15  1  0
 14 12  1  0
 12 13  2  0
 13 10  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 14  1  0
  1 19  1  0
 19 20  1  0
 20 21  2  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 20 22  1  0
 25 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4228325

    ---

Associated Targets(Human)

A-375 (9258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HT-29 (80576 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Braf Serine/threonine-protein kinase B-raf (85 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.49Molecular Weight (Monoisotopic): 447.1583AlogP: 6.46#Rotatable Bonds: 6
Polar Surface Area: 83.22Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.76CX LogD: 5.76
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.28Np Likeness Score: -1.00

References

1. Wang PF, Zhang YJ, Wang D, Hu HM, Wang ZC, Xu C, Qiu HY, Zhu HL..  (2018)  Design, synthesis, and biological evaluation of new B-RafV600E kinase inhibitors.,  26  (9): [PMID:29602674] [10.1016/j.bmc.2018.03.038]

Source