1-(4-(3,4-dichlorophenyl)-5-(isopropylthio)thiazol-2-yl)-4-(5-methoxypyridin-3-yl)-3-methyl-1H-pyrazole-5-carboxylic acid

ID: ALA4228369

PubChem CID: 124119827

Max Phase: Preclinical

Molecular Formula: C23H20Cl2N4O3S2

Molecular Weight: 535.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cncc(-c2c(C)nn(-c3nc(-c4ccc(Cl)c(Cl)c4)c(SC(C)C)s3)c2C(=O)O)c1

Standard InChI:  InChI=1S/C23H20Cl2N4O3S2/c1-11(2)33-22-19(13-5-6-16(24)17(25)8-13)27-23(34-22)29-20(21(30)31)18(12(3)28-29)14-7-15(32-4)10-26-9-14/h5-11H,1-4H3,(H,30,31)

Standard InChI Key:  NOLUBXJNJJXNEA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   26.2120   -4.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0292   -4.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2836   -4.1554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.6206   -3.6732    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9619   -4.1554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0634   -3.9006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7238   -4.3818    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   29.3856   -3.9024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1342   -3.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3170   -3.1238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.6146   -2.4681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4281   -2.5561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9091   -1.8964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5778   -1.1484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7607   -1.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2833   -1.7248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1845   -3.9032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7308   -5.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5088   -5.5938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1755   -6.3399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3216   -5.5093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.7217   -1.9833    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   31.0581   -0.4873    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   30.1625   -4.1560    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.3313   -4.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1081   -5.2092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7232   -5.5015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9178   -5.5016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4368   -6.1613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7681   -6.9092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5852   -6.9935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0626   -6.3329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6242   -6.0744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2931   -5.3273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  6  2  0
  3  6  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 11  1  0
  5 17  1  0
  1 18  1  0
  2 19  1  0
 19 20  1  0
 19 21  2  0
 13 22  1  0
 14 23  1  0
  8 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 18 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 18  1  0
 29 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4228369

    ---

Associated Targets(Human)

BJAB (157 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 535.48Molecular Weight (Monoisotopic): 534.0354AlogP: 6.88#Rotatable Bonds: 7
Polar Surface Area: 90.13Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 2.27CX Basic pKa: 5.20CX LogP: 4.83CX LogD: 2.87
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: -1.44

References

1. Cooper AB, Ciblat S, Shipps G, Levine J, Kostura M, Oza V, Constantineau-Forget L, Dery M, Grand-Maitre C, Bruneau-Latour N, Bellavance E, Patane M, Siddiqui A, Luther M..  (2017)  1-Thiazol-2-yl-N-3-methyl-1H-pyrozole-5-carboxylic acid derivatives as antitumor agents.,  27  (18): [PMID:28844391] [10.1016/j.bmcl.2017.08.003]

Source