1-(4-(3,4-dichlorophenyl)-5-(isopropylthio)thiazol-2-yl)-3-methyl-4-(pyrazin-2-yl)-1H-pyrazole-5-carboxylic acid

ID: ALA4228529

PubChem CID: 124108546

Max Phase: Preclinical

Molecular Formula: C21H17Cl2N5O2S2

Molecular Weight: 506.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nn(-c2nc(-c3ccc(Cl)c(Cl)c3)c(SC(C)C)s2)c(C(=O)O)c1-c1cnccn1

Standard InChI:  InChI=1S/C21H17Cl2N5O2S2/c1-10(2)31-20-17(12-4-5-13(22)14(23)8-12)26-21(32-20)28-18(19(29)30)16(11(3)27-28)15-9-24-6-7-25-15/h4-10H,1-3H3,(H,29,30)

Standard InChI Key:  GLHVEXREDGAVAX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    4.6761  -21.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4933  -21.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7477  -20.4208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0847  -19.9386    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4260  -20.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5275  -20.1660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1880  -20.6472    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.8498  -20.1678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5983  -19.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7811  -19.3892    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0787  -18.7336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8922  -18.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3733  -18.1618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0419  -17.4139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2248  -17.3295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7474  -17.9902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6487  -20.1686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1949  -21.8580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9729  -21.8592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6396  -22.6053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7857  -21.7747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1858  -18.2487    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.5222  -16.7527    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.6266  -20.4214    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.7954  -21.2210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5722  -21.4746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1873  -21.7669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3819  -21.7670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9009  -22.4267    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2322  -23.1746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0493  -23.2590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5267  -22.5983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  6  2  0
  3  6  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 11  1  0
  5 17  1  0
  1 18  1  0
  2 19  1  0
 19 20  1  0
 19 21  2  0
 13 22  1  0
 14 23  1  0
  8 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 18 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 18  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4228529

    ---

Associated Targets(Human)

BJAB (157 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.44Molecular Weight (Monoisotopic): 505.0201AlogP: 6.27#Rotatable Bonds: 6
Polar Surface Area: 93.79Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.32CX Basic pKa: 0.52CX LogP: 5.31CX LogD: 1.89
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.31Np Likeness Score: -1.67

References

1. Cooper AB, Ciblat S, Shipps G, Levine J, Kostura M, Oza V, Constantineau-Forget L, Dery M, Grand-Maitre C, Bruneau-Latour N, Bellavance E, Patane M, Siddiqui A, Luther M..  (2017)  1-Thiazol-2-yl-N-3-methyl-1H-pyrozole-5-carboxylic acid derivatives as antitumor agents.,  27  (18): [PMID:28844391] [10.1016/j.bmcl.2017.08.003]

Source