[(S)-1-(4-Chloro-3-methoxy-1-oxo-1H-isochromen-7-ylcarbamoyl)-2-(1H-indol-3-yl)-ethyl]-carbamic acid tert-butyl ester

ID: ALA422868

PubChem CID: 10459060

Max Phase: Preclinical

Molecular Formula: C26H26ClN3O6

Molecular Weight: 511.96

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1oc(=O)c2cc(NC(=O)[C@H](Cc3c[nH]c4ccccc34)NC(=O)OC(C)(C)C)ccc2c1Cl

Standard InChI:  InChI=1S/C26H26ClN3O6/c1-26(2,3)36-25(33)30-20(11-14-13-28-19-8-6-5-7-16(14)19)22(31)29-15-9-10-17-18(12-15)23(32)35-24(34-4)21(17)27/h5-10,12-13,20,28H,11H2,1-4H3,(H,29,31)(H,30,33)/t20-/m0/s1

Standard InChI Key:  QACAZQUWIZBSMS-FQEVSTJZSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  1  0  0  0  0  0999 V2000
    8.5542   -3.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5542   -2.6292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7917   -2.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7917   -3.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0292   -3.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0292   -2.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4542   -3.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4542   -0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9792   -2.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5792   -4.6417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6167   -3.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2167   -2.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2167   -1.3042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7417   -2.1792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9417   -4.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4542   -2.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2667   -3.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3917   -4.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2667   -2.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6917   -1.3042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7917   -1.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5042   -2.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4542    0.0208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9792   -3.4917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7917   -4.8292    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.9292   -0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3167   -3.9542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5042   -3.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8292   -4.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7292   -5.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1542   -1.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9292    0.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1542   -1.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0792   -3.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1667   -5.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6167   -5.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  1  2  0
  5  4  1  0
  6  5  2  0
  7 16  1  0
  8 13  1  0
  9 14  1  0
 10 11  1  0
 11  7  2  0
 12  9  1  0
 13 12  1  0
 14 22  1  0
 15  7  1  0
 12 16  1  6
 17  5  1  0
 18 15  2  0
 19  6  1  0
 20  8  1  0
 21  3  2  0
 22 28  1  0
 23  8  2  0
 24  9  2  0
 25  4  1  0
 26 20  1  0
 27  1  1  0
 28 17  2  0
 29 15  1  0
 30 18  1  0
 31 26  1  0
 32 26  1  0
 33 26  1  0
 34 27  1  0
 35 29  2  0
 36 35  1  0
  6  3  1  0
 19 22  2  0
 10 18  1  0
 36 30  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA422868

   tert-butyl N-[(2S)-1-[(4-chloro-3-methoxy-1-oxoisochromen-7-yl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 511.96

Molecular Weight (Monoisotopic): 511.1510

AlogP: 5.01

#Rotatable Bonds: 6

Polar Surface Area: 122.66

Molecular Species: NEUTRAL

HBA: 6

HBD: 3

#RO5 Violations: 2

HBA (Lipinski): 9

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 12.52

CX Basic pKa: ┄

CX LogP: 4.59

CX LogD: 4.59

Aromatic Rings: 4

Heavy Atoms: 36

QED Weighted: 0.33

Np Likeness Score: -0.54

References

1. Kerrigan JE, Oleksyszyn J, Kam CM, Selzler J, Powers JC..  (1995)  Mechanism-based isocoumarin inhibitors for human leukocyte elastase. Effect of the 7-amino substituent and 3-alkoxy group in 3-alkoxy-7-amino-4-chloroisocoumarins on inhibitory potency.,  38  (3): [PMID:7853347] [10.1021/jm00003a017]

Source

Source(1):

• Scientific Literature