2-Butyl-5-(4-chloro-benzyl)-3-[2'-(1H-tetrazol-5-yl)-biphenyl-4-ylmethyl]-3,5-dihydro-imidazo[4,5-c]pyridin-4-one

ID: ALA42287

PubChem CID: 10482664

Max Phase: Preclinical

Molecular Formula: C31H28ClN7O

Molecular Weight: 550.07

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCc1nc2ccn(Cc3ccc(Cl)cc3)c(=O)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1

Standard InChI:  InChI=1S/C31H28ClN7O/c1-2-3-8-28-33-27-17-18-38(19-21-11-15-24(32)16-12-21)31(40)29(27)39(28)20-22-9-13-23(14-10-22)25-6-4-5-7-26(25)30-34-36-37-35-30/h4-7,9-18H,2-3,8,19-20H2,1H3,(H,34,35,36,37)

Standard InChI Key:  KKEZJPJXBCCERR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
   -2.0875    2.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6625    2.4250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0875    3.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5750    2.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6625    3.4000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0208    2.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0583    2.6125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5000   -0.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2458    0.5583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6458    0.5083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4708    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5750    3.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0208   -0.3917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0583    3.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0333   -0.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4750   -0.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1875    2.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5333    2.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5750    1.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3833    0.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8458    0.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8208    0.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1875    1.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0125    2.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0292    3.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6208    2.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7250    1.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7500    1.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5417    3.5208    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.0125    3.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5042    2.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0250    2.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5042    3.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1333   -1.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0083   -0.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9208    3.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5208    3.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1000   -1.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6625   -1.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8208    3.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  2  0
  4  1  1  0
  5  3  1  0
  6  2  1  0
  7  4  1  0
  8 15  1  0
  9 10  2  0
 10  8  1  0
 11 13  1  0
 12  3  1  0
 13  8  2  0
 14  7  1  0
 15 16  2  0
 16 20  1  0
 17  2  1  0
 18  7  1  0
 19  4  2  0
 20 21  2  0
 21 28  1  0
 22 27  2  0
 23 17  1  0
 24 18  1  0
 25 32  2  0
 26  6  1  0
 27 23  1  0
 28 23  2  0
 29 25  1  0
 30 24  1  0
 31 24  2  0
 32 31  1  0
 33 30  2  0
 34 15  1  0
 35 16  1  0
 36 26  1  0
 37 36  1  0
 38 35  2  0
 39 38  1  0
 40 37  1  0
  6  5  2  0
 14 12  2  0
 22 20  1  0
 25 33  1  0
 39 34  2  0
 11  9  1  0
M  END

Associated Targets(Human)

AGTR1 Tclin Angiotensin II receptor (1039 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Agtr1b Angiotensin II receptor (AT-1) type-1 (1480 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 550.07Molecular Weight (Monoisotopic): 549.2044AlogP: 6.14#Rotatable Bonds: 9
Polar Surface Area: 94.28Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 5.85CX Basic pKa: 1.85CX LogP: 7.32CX LogD: 6.05
Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.23Np Likeness Score: -1.20

References

1. Mederski WW, Dorsch D, Bokel HH, Beier N, Lues I, Schelling P..  (1994)  Non-peptide angiotensin II receptor antagonists: synthesis and biological activity of a series of novel 4,5-dihydro-4-oxo-3H-imidazo[4,5-c]pyridine derivatives.,  37  (11): [PMID:8201597] [10.1021/jm00037a014]
2. Sharma MC, Kohli DV.  (2013)  A comprehensive structureactivity analysis 2,3,5-trisubstituted 4,5-dihydro-4-oxo-3H-imidazo [4,5-c] pyridine derivatives as angiotensin II receptor antagonists: using 2D- and 3D-QSAR approach,  22  (2): [10.1007/s00044-012-0040-z]

Source