1-(4-(3,4-dichlorophenyl)-5-(isopropylthio)thiazol-2-yl)-3-methyl-4-(3-(trifluoromethyl)phenyl)-1H-pyrazole-5-carboxylic acid

ID: ALA4228725

PubChem CID: 124108512

Max Phase: Preclinical

Molecular Formula: C24H18Cl2F3N3O2S2

Molecular Weight: 572.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nn(-c2nc(-c3ccc(Cl)c(Cl)c3)c(SC(C)C)s2)c(C(=O)O)c1-c1cccc(C(F)(F)F)c1

Standard InChI:  InChI=1S/C24H18Cl2F3N3O2S2/c1-11(2)35-22-19(14-7-8-16(25)17(26)10-14)30-23(36-22)32-20(21(33)34)18(12(3)31-32)13-5-4-6-15(9-13)24(27,28)29/h4-11H,1-3H3,(H,33,34)

Standard InChI Key:  CZYWMFFLRQDAET-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    4.4574   -6.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2746   -6.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5289   -5.7732    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8660   -5.2911    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2072   -5.7732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3087   -5.5185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9692   -5.9997    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.6310   -5.5203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3795   -4.7427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5624   -4.7417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8599   -4.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6735   -4.1739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1545   -3.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8232   -2.7663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0061   -2.6820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5287   -3.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4299   -5.5211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9762   -7.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7541   -7.2116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4209   -7.9578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5669   -7.1272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9671   -3.6012    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.3035   -2.1052    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.4078   -5.7739    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.5766   -6.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3535   -6.8270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9686   -7.1194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1632   -7.1195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6821   -7.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0135   -8.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8306   -8.6114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3080   -7.9508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8660   -7.6918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1266   -7.6128    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.3999   -6.9763    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2592   -8.2927    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  6  2  0
  3  6  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 11  1  0
  5 17  1  0
  1 18  1  0
  2 19  1  0
 19 20  1  0
 19 21  2  0
 13 22  1  0
 14 23  1  0
  8 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 18 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 18  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
 29 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4228725

    ---

Associated Targets(Human)

BJAB (157 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 572.46Molecular Weight (Monoisotopic): 571.0170AlogP: 8.50#Rotatable Bonds: 6
Polar Surface Area: 68.01Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.38CX Basic pKa: 0.44CX LogP: 8.24CX LogD: 4.83
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.23Np Likeness Score: -1.59

References

1. Cooper AB, Ciblat S, Shipps G, Levine J, Kostura M, Oza V, Constantineau-Forget L, Dery M, Grand-Maitre C, Bruneau-Latour N, Bellavance E, Patane M, Siddiqui A, Luther M..  (2017)  1-Thiazol-2-yl-N-3-methyl-1H-pyrozole-5-carboxylic acid derivatives as antitumor agents.,  27  (18): [PMID:28844391] [10.1016/j.bmcl.2017.08.003]

Source