4-(3-cyano-5-methoxyphenyl)-1-(4-(3,4-dichlorophenyl)-5-(isopropylthio)thiazol-2-yl)-3-methyl-1H-pyrazole-5-carboxylic acid

ID: ALA4228787

PubChem CID: 124119790

Max Phase: Preclinical

Molecular Formula: C25H20Cl2N4O3S2

Molecular Weight: 559.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(C#N)cc(-c2c(C)nn(-c3nc(-c4ccc(Cl)c(Cl)c4)c(SC(C)C)s3)c2C(=O)O)c1

Standard InChI:  InChI=1S/C25H20Cl2N4O3S2/c1-12(2)35-24-21(15-5-6-18(26)19(27)10-15)29-25(36-24)31-22(23(32)33)20(13(3)30-31)16-7-14(11-28)8-17(9-16)34-4/h5-10,12H,1-4H3,(H,32,33)

Standard InChI Key:  XTXXRIMNXMIIEE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   26.1460   -4.0447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9632   -4.0447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2175   -3.2680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.5546   -2.7859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.8958   -3.2680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9973   -3.0132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6578   -3.4945    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   29.3196   -3.0150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0681   -2.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2510   -2.2364    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5485   -1.5808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3621   -1.6687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8431   -1.0090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5118   -0.2611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6947   -0.1768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2173   -0.8374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1185   -3.0158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6648   -4.7052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4427   -4.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1095   -5.4526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2555   -4.6219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6557   -1.0959    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   30.9921    0.4006    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   30.0964   -3.2686    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.2652   -4.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0421   -4.3218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6572   -4.6142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8517   -4.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3707   -5.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7021   -6.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5192   -6.1062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9966   -5.4456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5582   -5.1871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2271   -4.4399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8539   -6.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1879   -7.5972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  6  2  0
  3  6  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 11  1  0
  5 17  1  0
  1 18  1  0
  2 19  1  0
 19 20  1  0
 19 21  2  0
 13 22  1  0
 14 23  1  0
  8 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 18 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 18  1  0
 29 33  1  0
 33 34  1  0
 35 36  3  0
 31 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4228787

    ---

Associated Targets(Human)

BJAB (157 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 559.50Molecular Weight (Monoisotopic): 558.0354AlogP: 7.36#Rotatable Bonds: 7
Polar Surface Area: 101.03Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.37CX Basic pKa: 0.44CX LogP: 7.06CX LogD: 3.65
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.24Np Likeness Score: -1.52

References

1. Cooper AB, Ciblat S, Shipps G, Levine J, Kostura M, Oza V, Constantineau-Forget L, Dery M, Grand-Maitre C, Bruneau-Latour N, Bellavance E, Patane M, Siddiqui A, Luther M..  (2017)  1-Thiazol-2-yl-N-3-methyl-1H-pyrozole-5-carboxylic acid derivatives as antitumor agents.,  27  (18): [PMID:28844391] [10.1016/j.bmcl.2017.08.003]

Source