The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(3,4-dichlorophenyl)-5-(isopropylthio)thiazol-2-yl)-4-(4-methoxyphenyl)-3-methyl-1H-pyrazole-5-carboxylic acid ID: ALA4228847
PubChem CID: 124119768
Max Phase: Preclinical
Molecular Formula: C24H21Cl2N3O3S2
Molecular Weight: 534.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2c(C)nn(-c3nc(-c4ccc(Cl)c(Cl)c4)c(SC(C)C)s3)c2C(=O)O)cc1
Standard InChI: InChI=1S/C24H21Cl2N3O3S2/c1-12(2)33-23-20(15-7-10-17(25)18(26)11-15)27-24(34-23)29-21(22(30)31)19(13(3)28-29)14-5-8-16(32-4)9-6-14/h5-12H,1-4H3,(H,30,31)
Standard InChI Key: UZRUYXNBGCPHKM-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
27.0044 -4.4409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8216 -4.4409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0760 -3.6642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4130 -3.1821 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7543 -3.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8558 -3.4095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5163 -3.8907 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.1781 -3.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9266 -2.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1094 -2.6326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.4070 -1.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2205 -2.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7016 -1.4053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3702 -0.6573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5531 -0.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0757 -1.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9770 -3.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5232 -5.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3012 -5.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9679 -5.8488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1140 -5.0181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.5141 -1.4921 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
31.8505 0.0044 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
30.9549 -3.6649 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.1237 -4.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9005 -4.7180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5156 -5.0104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7102 -5.0105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2292 -5.6701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5605 -6.4181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3776 -6.5024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8550 -5.8418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0802 -7.0792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2675 -6.9938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 2 0
5 1 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 6 2 0
3 6 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
9 11 1 0
5 17 1 0
1 18 1 0
2 19 1 0
19 20 1 0
19 21 2 0
13 22 1 0
14 23 1 0
8 24 1 0
24 25 1 0
25 26 1 0
25 27 1 0
18 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 18 1 0
30 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.49Molecular Weight (Monoisotopic): 533.0401AlogP: 7.49#Rotatable Bonds: 7Polar Surface Area: 77.24Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.38CX Basic pKa: 0.45CX LogP: 7.20CX LogD: 3.79Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: -1.32
References 1. Cooper AB, Ciblat S, Shipps G, Levine J, Kostura M, Oza V, Constantineau-Forget L, Dery M, Grand-Maitre C, Bruneau-Latour N, Bellavance E, Patane M, Siddiqui A, Luther M.. (2017) 1-Thiazol-2-yl-N-3-methyl-1H-pyrozole-5-carboxylic acid derivatives as antitumor agents., 27 (18): [PMID:28844391 ] [10.1016/j.bmcl.2017.08.003 ]