The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3,5-dichlorophenyl)-1-(5-(isopropylthio)-4-(pyridin-3-yl)thiazol-2-yl)-5-methyl-1H-pyrazole-3-carboxylic acid ID: ALA4229096
PubChem CID: 145988418
Max Phase: Preclinical
Molecular Formula: C22H18Cl2N4O2S2
Molecular Weight: 505.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(-c2cc(Cl)cc(Cl)c2)c(C(=O)O)nn1-c1nc(-c2cccnc2)c(SC(C)C)s1
Standard InChI: InChI=1S/C22H18Cl2N4O2S2/c1-11(2)31-21-18(13-5-4-6-25-10-13)26-22(32-21)28-12(3)17(19(27-28)20(29)30)14-7-15(23)9-16(24)8-14/h4-11H,1-3H3,(H,29,30)
Standard InChI Key: BRXSLZUMZPHQNM-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
25.9231 -5.0105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7403 -5.0105 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9947 -4.2338 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3317 -3.7517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6729 -4.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7718 -3.9827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4323 -4.4639 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.0940 -3.9845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8426 -3.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0254 -3.2059 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.8978 -3.9842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7287 -3.1836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9522 -2.9313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3442 -3.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5179 -4.2815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2942 -4.5300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3304 -2.9345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8709 -4.2381 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.0397 -5.0377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8165 -5.2913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4316 -5.5836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4419 -5.6710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6293 -5.5845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.7733 -6.4180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9128 -4.8307 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
23.7823 -2.1320 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
29.3196 -2.5472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1332 -2.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6142 -1.9754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2829 -1.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4658 -1.1432 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.9884 -1.8038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 2 0
5 1 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 6 2 0
3 6 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
5 11 1 0
4 17 1 0
8 18 1 0
18 19 1 0
19 20 1 0
19 21 1 0
1 22 1 0
22 23 2 0
22 24 1 0
15 25 1 0
13 26 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
9 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.45Molecular Weight (Monoisotopic): 504.0248AlogP: 6.87#Rotatable Bonds: 6Polar Surface Area: 80.90Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.07CX Basic pKa: 4.18CX LogP: 5.61CX LogD: 3.26Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.29Np Likeness Score: -1.45
References 1. Cooper AB, Ciblat S, Shipps G, Levine J, Kostura M, Oza V, Constantineau-Forget L, Dery M, Grand-Maitre C, Bruneau-Latour N, Bellavance E, Patane M, Siddiqui A, Luther M.. (2017) 1-Thiazol-2-yl-N-3-methyl-1H-pyrozole-5-carboxylic acid derivatives as antitumor agents., 27 (18): [PMID:28844391 ] [10.1016/j.bmcl.2017.08.003 ]