1-(4-(3,4-dichlorophenyl)-5-(isopropylthio)thiazol-2-yl)-4-(2-methoxy-5-methylphenyl)-3-methyl-1H-pyrazole-5-carboxylic acid

ID: ALA4229180

PubChem CID: 124119787

Max Phase: Preclinical

Molecular Formula: C25H23Cl2N3O3S2

Molecular Weight: 548.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(C)cc1-c1c(C)nn(-c2nc(-c3ccc(Cl)c(Cl)c3)c(SC(C)C)s2)c1C(=O)O

Standard InChI:  InChI=1S/C25H23Cl2N3O3S2/c1-12(2)34-24-21(15-7-8-17(26)18(27)11-15)28-25(35-24)30-22(23(31)32)20(14(4)29-30)16-10-13(3)6-9-19(16)33-5/h6-12H,1-5H3,(H,31,32)

Standard InChI Key:  IUQPURIMGKNDDY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   15.3161  -11.8452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1333  -11.8452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3877  -11.0685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7247  -10.5863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0660  -11.0685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1675  -10.8137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8280  -11.2949    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.4897  -10.8155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2383  -10.0379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4211  -10.0369    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7187   -9.3813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5322   -9.4692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0133   -8.8095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6819   -8.0616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8648   -7.9772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3874   -8.6379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2887  -10.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8349  -12.5057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6129  -12.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2796  -13.2530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4257  -12.4224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8258   -8.8964    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   20.1622   -7.4004    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   19.2666  -11.0691    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.4354  -11.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2122  -12.1223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8273  -12.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0219  -12.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5409  -13.0744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8722  -13.8223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6893  -13.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1667  -13.2460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6927  -11.6668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8803  -11.5779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0234  -14.6525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  6  2  0
  3  6  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 11  1  0
  5 17  1  0
  1 18  1  0
  2 19  1  0
 19 20  1  0
 19 21  2  0
 13 22  1  0
 14 23  1  0
  8 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 18 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 18  1  0
 28 33  1  0
 33 34  1  0
 31 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4229180

    ---

Associated Targets(Human)

BJAB (157 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 548.52Molecular Weight (Monoisotopic): 547.0558AlogP: 7.79#Rotatable Bonds: 7
Polar Surface Area: 77.24Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.36CX Basic pKa: 0.41CX LogP: 7.72CX LogD: 4.30
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.24Np Likeness Score: -1.29

References

1. Cooper AB, Ciblat S, Shipps G, Levine J, Kostura M, Oza V, Constantineau-Forget L, Dery M, Grand-Maitre C, Bruneau-Latour N, Bellavance E, Patane M, Siddiqui A, Luther M..  (2017)  1-Thiazol-2-yl-N-3-methyl-1H-pyrozole-5-carboxylic acid derivatives as antitumor agents.,  27  (18): [PMID:28844391] [10.1016/j.bmcl.2017.08.003]

Source