The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-fluoro-3-(3-oxo-3-(phenethylamino)propyl)phenyl)-N-(1H-indazol-5-yl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide ID: ALA4229210
PubChem CID: 118888938
Max Phase: Preclinical
Molecular Formula: C30H29FN6O3
Molecular Weight: 540.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)Nc2ccc3[nH]ncc3c2)C(c2ccc(F)c(CCC(=O)NCCc3ccccc3)c2)NC(=O)N1
Standard InChI: InChI=1S/C30H29FN6O3/c1-18-27(29(39)35-23-9-11-25-22(16-23)17-33-37-25)28(36-30(40)34-18)21-7-10-24(31)20(15-21)8-12-26(38)32-14-13-19-5-3-2-4-6-19/h2-7,9-11,15-17,28H,8,12-14H2,1H3,(H,32,38)(H,33,37)(H,35,39)(H2,34,36,40)
Standard InChI Key: PWXKFBLJDGXQBF-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
21.4203 -9.6234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1368 -9.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1339 -8.3795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4185 -7.9705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7055 -9.2106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7068 -8.3816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9188 -8.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4305 -8.7942 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9168 -9.4655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8468 -7.9644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5628 -8.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2757 -7.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5659 -9.1992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.9904 -8.3715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7011 -7.9599 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7023 -7.1345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9864 -6.7226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2693 -7.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5545 -6.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5529 -5.9008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8378 -5.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1239 -5.9059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1294 -6.7352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8451 -7.1413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9909 -9.1965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4167 -6.7220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4074 -5.4969 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.8353 -4.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5485 -4.2512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5460 -3.4262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2592 -3.0116 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8303 -3.0159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1171 -3.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4014 -3.0203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6882 -3.4349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9747 -3.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2621 -3.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2641 -4.2615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9848 -4.6717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6946 -4.2553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
3 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 2 0
12 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
18 19 1 0
14 25 1 0
16 26 2 0
22 27 1 0
21 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
30 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.60Molecular Weight (Monoisotopic): 540.2285AlogP: 4.26#Rotatable Bonds: 9Polar Surface Area: 128.01Molecular Species: NEUTRALHBA: 4HBD: 5#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.03CX Basic pKa: 1.71CX LogP: 2.92CX LogD: 2.92Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.22Np Likeness Score: -1.61
References 1. Waldschmidt HV, Bouley R, Kirchhoff PD, Lee P, Tesmer JJG, Larsen SD.. (2018) Utilizing a structure-based docking approach to develop potent G protein-coupled receptor kinase (GRK) 2 and 5 inhibitors., 28 (9): [PMID:29627263 ] [10.1016/j.bmcl.2018.03.082 ]