1-(4-(3,4-dichlorophenyl)-5-(isopropylthio)thiazol-2-yl)-3-methyl-4-(4-(trifluoromethyl)phenyl)-1H-pyrazole-5-carboxylic acid

ID: ALA4229245

PubChem CID: 124108430

Max Phase: Preclinical

Molecular Formula: C24H18Cl2F3N3O2S2

Molecular Weight: 572.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nn(-c2nc(-c3ccc(Cl)c(Cl)c3)c(SC(C)C)s2)c(C(=O)O)c1-c1ccc(C(F)(F)F)cc1

Standard InChI:  InChI=1S/C24H18Cl2F3N3O2S2/c1-11(2)35-22-19(14-6-9-16(25)17(26)10-14)30-23(36-22)32-20(21(33)34)18(12(3)31-32)13-4-7-15(8-5-13)24(27,28)29/h4-11H,1-3H3,(H,33,34)

Standard InChI Key:  WOYNMHCUEOKFQF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   16.6616  -21.0819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4788  -21.0819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7331  -20.3052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0702  -19.8231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4114  -20.3052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5130  -20.0504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1734  -20.5317    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.8352  -20.0522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5838  -19.2746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7666  -19.2736    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0642  -18.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8777  -18.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3587  -18.0462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0274  -17.2983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2103  -17.2140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7329  -17.8746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6341  -20.0530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1804  -21.7424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9583  -21.7436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6251  -22.4898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7712  -21.6591    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1713  -18.1331    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   21.5077  -16.6372    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   20.6121  -20.3058    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.7809  -21.1054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5577  -21.3590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1728  -21.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3674  -21.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8864  -22.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2177  -23.0591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0348  -23.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5122  -22.4828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7396  -23.7232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3025  -24.3248    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.8869  -23.7706    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.9580  -24.5488    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  6  2  0
  3  6  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 11  1  0
  5 17  1  0
  1 18  1  0
  2 19  1  0
 19 20  1  0
 19 21  2  0
 13 22  1  0
 14 23  1  0
  8 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 18 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 18  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
 30 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4229245

    ---

Associated Targets(Human)

BJAB (157 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 572.46Molecular Weight (Monoisotopic): 571.0170AlogP: 8.50#Rotatable Bonds: 6
Polar Surface Area: 68.01Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.38CX Basic pKa: 0.44CX LogP: 8.24CX LogD: 4.83
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.23Np Likeness Score: -1.50

References

1. Cooper AB, Ciblat S, Shipps G, Levine J, Kostura M, Oza V, Constantineau-Forget L, Dery M, Grand-Maitre C, Bruneau-Latour N, Bellavance E, Patane M, Siddiqui A, Luther M..  (2017)  1-Thiazol-2-yl-N-3-methyl-1H-pyrozole-5-carboxylic acid derivatives as antitumor agents.,  27  (18): [PMID:28844391] [10.1016/j.bmcl.2017.08.003]

Source