1-[2-(3,4-Dimethoxy-phenyl)-ethylamino]-3-(5,6,7,8,9,9a-hexahydro-4bH-benzo[3,4]cyclobuta[1,2]cyclohepten-1-yloxy)-propan-2-ol

ID: ALA423078

PubChem CID: 44379222

Max Phase: Preclinical

Molecular Formula: C26H35NO4

Molecular Weight: 425.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CCNCC(O)COc2cccc3c2[C@@H]2CCCCC[C@H]32)cc1OC

Standard InChI:  InChI=1S/C26H35NO4/c1-29-23-12-11-18(15-25(23)30-2)13-14-27-16-19(28)17-31-24-10-6-9-22-20-7-4-3-5-8-21(20)26(22)24/h6,9-12,15,19-21,27-28H,3-5,7-8,13-14,16-17H2,1-2H3/t19?,20-,21+/m0/s1

Standard InChI Key:  GCOKFZQRNQCLIH-GJGLBJJNSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  1  0  0  0  0  0999 V2000
    0.8417   -2.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8417   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4500   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4542   -2.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2958    0.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3250   -1.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8208    0.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3292   -1.1542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7833    0.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8208    0.0583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1958   -0.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3250   -2.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7833    0.0583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7125   -1.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3000   -0.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2958    1.5583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9250   -1.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7500   -1.1500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3458    0.9583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9250   -3.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7208   -1.7542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1958   -2.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1958   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2333   -0.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2708   -0.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2708   -0.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8208    1.8583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3458    1.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5042   -1.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5167   -2.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7750   -2.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4500   -3.2625    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4417   -1.4542    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  4  1  0
  4  1  1  0
  5  9  1  0
  6  2  2  0
  7 10  1  0
  8  6  1  0
  9 13  2  0
 10 15  2  0
 11  8  1  0
 12  1  2  0
 13 26  1  0
 14 11  1  0
 15 13  1  0
 16  5  1  0
 17  3  1  0
 18 24  1  0
 19  7  1  0
 20  4  1  0
 21 14  1  0
 22 12  1  0
 23 22  2  0
 24 14  1  0
 25 18  1  0
 26 25  1  0
 27 16  1  0
 28 19  1  0
 29 17  1  0
 30 20  1  0
 31 30  1  0
  4 32  1  1
  3 33  1  1
  3  2  1  0
  6 23  1  0
 29 31  1  0
  5  7  2  0
M  END

Associated Targets(Human)

ADRB1 Tclin Adrenergic receptor beta; ADRB1 & ADRB2 (240 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cavia porcellus (23802 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.57Molecular Weight (Monoisotopic): 425.2566AlogP: 4.42#Rotatable Bonds: 10
Polar Surface Area: 59.95Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.31CX LogP: 4.53CX LogD: 2.63
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.55Np Likeness Score: -0.02

References

1. Carre MC, Youlassani A, Caubere P, Saint-Aubin-Floch A, Blanc M, Advenier C..  (1984)  Synthesis of a novel series of (aryloxy)propanolamines: new selective beta 2-blocking agents.,  27  (6): [PMID:6145801] [10.1021/jm00372a016]

Source