The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-(benzo[d][1,3]dioxol-5-ylmethylamino)-2-(2-(4-(chloromethyl)benzamido)acetamido)-3-oxopropyl dihydrogen phosphate ID: ALA4237531
PubChem CID: 145983450
Max Phase: Preclinical
Molecular Formula: C21H23ClN3O9P
Molecular Weight: 527.85
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CNC(=O)c1ccc(CCl)cc1)N[C@@H](COP(=O)(O)O)C(=O)NCc1ccc2c(c1)OCO2
Standard InChI: InChI=1S/C21H23ClN3O9P/c22-8-13-1-4-15(5-2-13)20(27)24-10-19(26)25-16(11-34-35(29,30)31)21(28)23-9-14-3-6-17-18(7-14)33-12-32-17/h1-7,16H,8-12H2,(H,23,28)(H,24,27)(H,25,26)(H2,29,30,31)/t16-/m0/s1
Standard InChI Key: LRDBMUOWCPZQDD-INIZCTEOSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
31.4123 -9.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1200 -8.9602 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.7046 -8.9602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4123 -10.1860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9969 -9.3688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2892 -8.9602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5815 -9.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2892 -8.1430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8745 -8.9569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1672 -9.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1668 -10.1829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8795 -10.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5838 -10.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8278 -9.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5355 -8.9602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8278 -10.1860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2432 -9.3688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5355 -8.1430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5355 -10.5946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5355 -11.4118 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
34.2432 -11.8204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.8278 -11.8204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.2395 -10.9949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9509 -8.9602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6586 -9.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4596 -10.5924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7514 -10.1848 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
35.6565 -10.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3634 -10.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3620 -8.9607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0694 -9.3655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0730 -10.1855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8540 -10.4354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.3331 -9.7699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8481 -9.1088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
7 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 7 1 0
2 14 1 0
14 15 1 0
14 16 1 6
15 17 1 0
15 18 2 0
16 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
20 23 1 0
17 24 1 0
24 25 1 0
11 26 1 0
26 27 1 0
25 28 2 0
28 29 1 0
29 32 2 0
31 30 2 0
30 25 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.85Molecular Weight (Monoisotopic): 527.0860AlogP: 0.79#Rotatable Bonds: 11Polar Surface Area: 172.52Molecular Species: ACIDHBA: 7HBD: 5#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.36CX Basic pKa: ┄CX LogP: 0.17CX LogD: -3.24Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.21Np Likeness Score: -0.46
References 1. Stevers LM, Sijbesma E, Botta M, MacKintosh C, Obsil T, Landrieu I, Cau Y, Wilson AJ, Karawajczyk A, Eickhoff J, Davis J, Hann M, O'Mahony G, Doveston RG, Brunsveld L, Ottmann C.. (2018) Modulators of 14-3-3 Protein-Protein Interactions., 61 (9): [PMID:28968506 ] [10.1021/acs.jmedchem.7b00574 ]