The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5-nitrofuran-2-yl)methyl P-(S)-3-(2-(4-aminobenzamido)acetamido)-1,1-difluoro-4-(4-hydroxyphenethylamino)-4-oxobutyl-N-(4-chlorobutyl)-N-methylphosphonamidate ID: ALA4237884
PubChem CID: 145984426
Max Phase: Preclinical
Molecular Formula: C31H38ClF2N6O9P
Molecular Weight: 743.10
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(CCCCCl)P(=O)(OCc1ccc([N+](=O)[O-])o1)C(F)(F)C[C@H](NC(=O)CNC(=O)c1ccc(N)cc1)C(=O)NCCc1ccc(O)cc1
Standard InChI: InChI=1S/C31H38ClF2N6O9P/c1-39(17-3-2-15-32)50(47,48-20-25-12-13-28(49-25)40(45)46)31(33,34)18-26(30(44)36-16-14-21-4-10-24(41)11-5-21)38-27(42)19-37-29(43)22-6-8-23(35)9-7-22/h4-13,26,41H,2-3,14-20,35H2,1H3,(H,36,44)(H,37,43)(H,38,42)/t26-,50?/m0/s1
Standard InChI Key: FOOUDSNEJGISFX-PHJSXTQASA-N
Molfile:
RDKit 2D
50 52 0 0 0 0 0 0 0 0999 V2000
9.8888 -17.3179 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.4844 -18.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3014 -18.0231 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.3630 -16.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0707 -16.3934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6553 -16.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3630 -17.6191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9476 -16.8019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2399 -16.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5321 -16.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2399 -15.5762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8251 -16.3900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1179 -16.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1174 -17.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8301 -18.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5344 -17.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7784 -16.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4861 -16.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7784 -17.6191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1938 -16.8019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4861 -15.5762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4861 -18.8449 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
9.9833 -19.4558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7784 -19.2535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9015 -16.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6092 -16.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3169 -16.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0236 -16.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7308 -16.3981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7312 -15.5800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0185 -15.1716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3142 -15.5818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4384 -15.1705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4103 -18.0256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3016 -18.8449 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7102 -19.5526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7102 -18.1372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5273 -19.5526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9359 -20.2603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7531 -20.2603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1617 -20.9681 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.6924 -20.2194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8856 -20.3493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3077 -19.7775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5805 -20.1504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7104 -20.9573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5179 -21.0829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1340 -21.5392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3476 -22.3280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3441 -21.3298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
4 6 1 0
4 7 2 0
6 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 10 1 0
5 17 1 0
17 18 1 0
17 19 1 6
18 20 1 0
18 21 2 0
19 2 1 0
2 22 1 0
22 23 1 0
22 24 2 0
20 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
14 34 1 0
22 35 1 0
35 36 1 0
35 37 1 0
36 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
23 42 1 0
42 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 47 1 0
47 43 1 0
48 49 2 0
48 50 1 0
46 48 1 0
M CHG 2 48 1 50 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 743.10Molecular Weight (Monoisotopic): 742.2094AlogP: 4.39#Rotatable Bonds: 20Polar Surface Area: 219.37Molecular Species: NEUTRALHBA: 10HBD: 5#RO5 Violations: 1HBA (Lipinski): 15HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 9.50CX Basic pKa: 3.27CX LogP: 2.14CX LogD: 2.13Aromatic Rings: 3Heavy Atoms: 50QED Weighted: 0.03Np Likeness Score: -0.67
References 1. Stevers LM, Sijbesma E, Botta M, MacKintosh C, Obsil T, Landrieu I, Cau Y, Wilson AJ, Karawajczyk A, Eickhoff J, Davis J, Hann M, O'Mahony G, Doveston RG, Brunsveld L, Ottmann C.. (2018) Modulators of 14-3-3 Protein-Protein Interactions., 61 (9): [PMID:28968506 ] [10.1021/acs.jmedchem.7b00574 ]