tert-butyl (4-((3-(bis(naphthalen-2-ylmethyl)amino)propyl)amino)butyl)carbamate

ID: ALA4238355

PubChem CID: 145983229

Max Phase: Preclinical

Molecular Formula: C34H43N3O2

Molecular Weight: 525.74

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)OC(=O)NCCCCNCCCN(Cc1ccc2ccccc2c1)Cc1ccc2ccccc2c1

Standard InChI:  InChI=1S/C34H43N3O2/c1-34(2,3)39-33(38)36-21-9-8-19-35-20-10-22-37(25-27-15-17-29-11-4-6-13-31(29)23-27)26-28-16-18-30-12-5-7-14-32(30)24-28/h4-7,11-18,23-24,35H,8-10,19-22,25-26H2,1-3H3,(H,36,38)

Standard InChI Key:  AJBJCLKGBDXIMK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   24.5281  -16.3356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2358  -15.9270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9435  -16.3356    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.8204  -15.9270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1127  -16.3356    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.6512  -15.9270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3590  -16.3356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0667  -15.9270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7744  -16.3356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4821  -15.9270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4050  -15.9270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1127  -17.1528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8204  -17.5614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6973  -16.3356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1898  -16.3356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8975  -15.9270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1898  -17.1528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6052  -16.3356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3129  -15.9270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6052  -17.1528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3079  -16.7400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9903  -15.9237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9953  -17.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6996  -17.1478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8155  -18.3796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2284  -17.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5210  -17.1532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2826  -17.1497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2833  -16.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5780  -15.9267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8715  -16.3348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8748  -17.1540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5806  -17.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2310  -18.3795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5243  -18.7859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5239  -19.5993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2295  -20.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9370  -19.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9339  -18.7838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  1  0
  4  5  1  0
  3  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  5 11  1  0
  5 12  1  0
 12 13  1  0
 11 14  1  0
 10 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 18 19  1  0
 18 20  1  0
 18 21  1  0
 14 22  2  0
 22 29  1  0
 28 23  1  0
 23 24  2  0
 24 14  1  0
 13 25  2  0
 25 35  1  0
 34 26  1  0
 26 27  2  0
 27 13  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 28  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 34  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4238355

    ---

Associated Targets(non-human)

Trypanosoma brucei gambiense (523 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Leishmania donovani (89745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RAW264.7 (28094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TPR Trypanothione reductase (189 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 525.74Molecular Weight (Monoisotopic): 525.3355AlogP: 7.28#Rotatable Bonds: 13
Polar Surface Area: 53.60Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.12CX LogP: 6.59CX LogD: 3.70
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.18Np Likeness Score: -0.74

References

1. Jagu E, Pomel S, Diez-Martinez A, Rascol E, Pethe S, Loiseau PM, Labruère R..  (2018)  Synthesis and antikinetoplastid evaluation of bis(benzyl)spermidine derivatives.,  150  [PMID:29567458] [10.1016/j.ejmech.2018.02.087]

Source