The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl (4-((3-(bis(naphthalen-2-ylmethyl)amino)propyl)amino)butyl)carbamate ID: ALA4238355
PubChem CID: 145983229
Max Phase: Preclinical
Molecular Formula: C34H43N3O2
Molecular Weight: 525.74
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)NCCCCNCCCN(Cc1ccc2ccccc2c1)Cc1ccc2ccccc2c1
Standard InChI: InChI=1S/C34H43N3O2/c1-34(2,3)39-33(38)36-21-9-8-19-35-20-10-22-37(25-27-15-17-29-11-4-6-13-31(29)23-27)26-28-16-18-30-12-5-7-14-32(30)24-28/h4-7,11-18,23-24,35H,8-10,19-22,25-26H2,1-3H3,(H,36,38)
Standard InChI Key: AJBJCLKGBDXIMK-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
24.5281 -16.3356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2358 -15.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9435 -16.3356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8204 -15.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1127 -16.3356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6512 -15.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3590 -16.3356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0667 -15.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7744 -16.3356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4821 -15.9270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4050 -15.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1127 -17.1528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8204 -17.5614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6973 -16.3356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1898 -16.3356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8975 -15.9270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1898 -17.1528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6052 -16.3356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3129 -15.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6052 -17.1528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3079 -16.7400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9903 -15.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9953 -17.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6996 -17.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8155 -18.3796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2284 -17.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5210 -17.1532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2826 -17.1497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2833 -16.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5780 -15.9267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8715 -16.3348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8748 -17.1540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5806 -17.5572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2310 -18.3795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5243 -18.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5239 -19.5993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2295 -20.0073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9370 -19.5959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9339 -18.7838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
1 4 1 0
4 5 1 0
3 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
5 11 1 0
5 12 1 0
12 13 1 0
11 14 1 0
10 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
18 19 1 0
18 20 1 0
18 21 1 0
14 22 2 0
22 29 1 0
28 23 1 0
23 24 2 0
24 14 1 0
13 25 2 0
25 35 1 0
34 26 1 0
26 27 2 0
27 13 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 28 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 34 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 525.74Molecular Weight (Monoisotopic): 525.3355AlogP: 7.28#Rotatable Bonds: 13Polar Surface Area: 53.60Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.12CX LogP: 6.59CX LogD: 3.70Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.18Np Likeness Score: -0.74
References 1. Jagu E, Pomel S, Diez-Martinez A, Rascol E, Pethe S, Loiseau PM, Labruère R.. (2018) Synthesis and antikinetoplastid evaluation of bis(benzyl)spermidine derivatives., 150 [PMID:29567458 ] [10.1016/j.ejmech.2018.02.087 ]