The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-15-(N-4-Bromo-1-naphthyl)sophoridinic imine ID: ALA4238594
PubChem CID: 145983230
Max Phase: Preclinical
Molecular Formula: C25H30BrN3
Molecular Weight: 452.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Brc1ccc(/N=C2\CCC[C@@H]3[C@H]4CCCN5CCC[C@H](CN23)[C@@H]45)c2ccccc12
Standard InChI: InChI=1S/C25H30BrN3/c26-21-12-13-22(19-8-2-1-7-18(19)21)27-24-11-3-10-23-20-9-5-15-28-14-4-6-17(25(20)28)16-29(23)24/h1-2,7-8,12-13,17,20,23,25H,3-6,9-11,14-16H2/b27-24+/t17-,20-,23-,25+/m1/s1
Standard InChI Key: UETHRKWPGIPNOD-RSLQCYLQSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
20.1202 -24.0452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1202 -24.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8255 -25.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5273 -24.8624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2294 -25.2717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9394 -24.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9429 -24.0512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8255 -23.6325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5290 -24.0482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2369 -23.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8298 -22.8176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5439 -22.4168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2497 -22.8360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9617 -22.4365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9740 -21.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2682 -21.1972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5500 -21.5982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8468 -21.1819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5235 -23.2280 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
22.2293 -24.4662 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
22.9515 -23.2446 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
20.8177 -24.4497 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
20.8557 -20.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5696 -19.9670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5788 -19.1506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8751 -18.7335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1548 -19.9538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1622 -19.1414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4634 -18.7306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7567 -19.1311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7533 -19.9467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4527 -20.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8814 -17.9164 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 8 1 0
2 3 1 0
3 4 1 0
9 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 10 1 0
8 9 1 0
8 11 1 0
9 10 1 0
10 13 1 0
12 11 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
9 19 1 6
10 20 1 6
13 21 1 1
8 22 1 1
18 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 28 1 0
27 23 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 27 2 0
26 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.44Molecular Weight (Monoisotopic): 451.1623AlogP: 5.99#Rotatable Bonds: 1Polar Surface Area: 18.84Molecular Species: BASEHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.79CX LogP: 5.05CX LogD: 3.27Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.53Np Likeness Score: 0.18
References 1. Xu Y, Jing D, Chen R, Rashid HU, Jiang J, Liu X, Wang L, Xie P.. (2018) Design, synthesis and evaluation of novel sophoridinic imine derivatives containing conjugated planar structure as potent anticancer agents., 26 (14): [PMID:30007563 ] [10.1016/j.bmc.2018.07.001 ]