5-Benzyl-2-butyl-3-[2'-(1H-tetrazol-5-yl)-biphenyl-4-ylmethyl]-3,5-dihydro-imidazo[4,5-c]pyridin-4-one

ID: ALA42397

PubChem CID: 9806554

Max Phase: Preclinical

Molecular Formula: C31H29N7O

Molecular Weight: 515.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCc1nc2ccn(Cc3ccccc3)c(=O)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1

Standard InChI:  InChI=1S/C31H29N7O/c1-2-3-13-28-32-27-18-19-37(20-22-9-5-4-6-10-22)31(39)29(27)38(28)21-23-14-16-24(17-15-23)25-11-7-8-12-26(25)30-33-35-36-34-30/h4-12,14-19H,2-3,13,20-21H2,1H3,(H,33,34,35,36)

Standard InChI Key:  ABXPQQANEFDOLU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
   -0.9500    3.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5208    3.3458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9458    4.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4333    3.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5208    4.3167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8750    3.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0875    3.5333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3583    0.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1000    1.4750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5000    1.4250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3333    0.9208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4333    4.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8750    0.5333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0875    4.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8958    0.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3333    0.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0458    3.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6042    3.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4333    2.6333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2375    1.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7083    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6750    1.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0500    2.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4750    3.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1292    3.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6083    2.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5833    2.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9875   -0.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8708    0.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6500    3.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1292    4.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7750    4.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3750    4.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9583   -0.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5208   -0.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6750    4.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6500    4.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1667    3.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1667    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  2  0
  4  1  1  0
  5  3  1  0
  6  2  1  0
  7  4  1  0
  8 15  1  0
  9 10  2  0
 10  8  1  0
 11 13  1  0
 12  3  1  0
 13  8  2  0
 14  7  1  0
 15 16  2  0
 16 20  1  0
 17  2  1  0
 18  7  1  0
 19  4  2  0
 20 22  2  0
 21 26  2  0
 22 27  1  0
 23 17  1  0
 24  6  1  0
 25 18  1  0
 26 23  1  0
 27 23  2  0
 28 15  1  0
 29 16  1  0
 30 25  2  0
 31 25  1  0
 32 24  1  0
 33 32  1  0
 34 29  2  0
 35 34  1  0
 36 33  1  0
 37 31  2  0
 38 30  1  0
 39 37  1  0
  6  5  2  0
 14 12  2  0
 20 21  1  0
 39 38  2  0
 35 28  2  0
 11  9  1  0
M  END

Associated Targets(Human)

AGTR1 Tclin Angiotensin II receptor (1039 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Agtr1b Angiotensin II receptor (AT-1) type-1 (1480 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Agtr1b Type-1B angiotensin II receptor (525 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 515.62Molecular Weight (Monoisotopic): 515.2434AlogP: 5.48#Rotatable Bonds: 9
Polar Surface Area: 94.28Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 5.85CX Basic pKa: 1.85CX LogP: 6.75CX LogD: 5.49
Aromatic Rings: 6Heavy Atoms: 39QED Weighted: 0.28Np Likeness Score: -1.07

References

1. Mederski WW, Dorsch D, Bokel HH, Beier N, Lues I, Schelling P..  (1994)  Non-peptide angiotensin II receptor antagonists: synthesis and biological activity of a series of novel 4,5-dihydro-4-oxo-3H-imidazo[4,5-c]pyridine derivatives.,  37  (11): [PMID:8201597] [10.1021/jm00037a014]
2. Sharma MC, Kohli DV.  (2013)  A comprehensive structureactivity analysis 2,3,5-trisubstituted 4,5-dihydro-4-oxo-3H-imidazo [4,5-c] pyridine derivatives as angiotensin II receptor antagonists: using 2D- and 3D-QSAR approach,  22  (2): [10.1007/s00044-012-0040-z]

Source