The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(6R,7R)-7-(3-(2-hydroxy-5-isobutyl-4-oxo-4,5-dihydro-1H-pyrrole-3-carboxamido)propanamido)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid ID: ALA4242024
PubChem CID: 145983277
Max Phase: Preclinical
Molecular Formula: C20H26N4O7S
Molecular Weight: 466.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)CCNC(=O)C3=C(O)C(CC(C)C)NC3=O)[C@H]2SC1
Standard InChI: InChI=1S/C20H26N4O7S/c1-8(2)6-10-15(26)12(17(28)22-10)16(27)21-5-4-11(25)23-13-18(29)24-14(20(30)31)9(3)7-32-19(13)24/h8,10,13,19,26H,4-7H2,1-3H3,(H,21,27)(H,22,28)(H,23,25)(H,30,31)/t10?,13-,19-/m1/s1
Standard InChI Key: MKKYHAJZZRMBOT-PLVDWWEDSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
15.8769 -9.4086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2778 -8.6965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0794 -8.8559 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1742 -9.6702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4309 -10.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2693 -10.8087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9365 -7.9540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8857 -10.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5896 -9.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3010 -10.0591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5820 -8.8399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6410 -8.7185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0597 -9.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6613 -10.1338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0382 -5.1813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8554 -5.1813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0432 -6.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8604 -6.5938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6321 -5.8904 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4332 -5.7591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3256 -4.7669 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.0365 -4.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8554 -4.3641 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2601 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8504 -2.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0315 -2.9519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6223 -3.6632 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.0773 -3.6557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4874 -4.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4844 -2.9471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2575 -2.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6371 -7.3058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0483 -8.0121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 2 0
5 6 1 0
2 7 2 0
4 8 1 0
8 9 1 0
9 10 1 0
9 11 1 0
12 13 1 0
13 1 1 0
13 14 2 0
22 15 1 0
15 16 1 0
16 23 1 0
17 18 2 0
17 19 1 0
15 19 1 1
16 20 2 0
22 21 1 6
22 23 1 0
22 27 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
24 28 1 0
28 29 2 0
28 30 1 0
25 31 1 0
17 32 1 0
32 33 1 0
33 12 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.52Molecular Weight (Monoisotopic): 466.1522AlogP: -0.39#Rotatable Bonds: 8Polar Surface Area: 165.14Molecular Species: ACIDHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.62CX Basic pKa: ┄CX LogP: -1.38CX LogD: -6.83Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.24Np Likeness Score: 0.20
References 1. Cherian PT, Cheramie MN, Marreddy RKR, Fernando DM, Hurdle JG, Lee RE.. (2018) New β-lactam - Tetramic acid hybrids show promising antibacterial activities., 28 (18): [PMID:30097368 ] [10.1016/j.bmcl.2018.07.018 ]