The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1,N1-bis(3-(bis(4-fluorobenzyl)amino)propyl)butane-1,4-diamine ID: ALA4242261
PubChem CID: 145983283
Max Phase: Preclinical
Molecular Formula: C38H46F4N4
Molecular Weight: 634.81
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCCCN(CCCN(Cc1ccc(F)cc1)Cc1ccc(F)cc1)CCCN(Cc1ccc(F)cc1)Cc1ccc(F)cc1
Standard InChI: InChI=1S/C38H46F4N4/c39-35-13-5-31(6-14-35)27-45(28-32-7-15-36(40)16-8-32)25-3-23-44(22-2-1-21-43)24-4-26-46(29-33-9-17-37(41)18-10-33)30-34-11-19-38(42)20-12-34/h5-20H,1-4,21-30,43H2
Standard InChI Key: PLIZBZTXWNQWSP-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 49 0 0 0 0 0 0 0 0999 V2000
18.9729 -18.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6806 -18.1020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2652 -18.1020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5575 -18.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8497 -18.1020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6806 -17.2848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3883 -18.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0960 -18.1020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8037 -18.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5114 -18.1020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9729 -16.8762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9729 -16.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2652 -15.6505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2652 -14.8333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1420 -18.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8497 -17.2848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1420 -16.8762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1420 -19.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2191 -18.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5114 -17.2848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2191 -16.8762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1452 -16.0580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4384 -15.6495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7297 -16.0581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7323 -16.8795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4398 -17.2843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4318 -19.7342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4315 -20.5506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1397 -20.9600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8498 -20.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8466 -19.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9267 -17.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6339 -16.8793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6344 -16.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9217 -15.6528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2174 -16.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2191 -19.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5094 -19.7351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5091 -20.5516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2173 -20.9610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9274 -20.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9243 -19.7329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1408 -21.7772 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.0214 -15.6505 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.2184 -21.7782 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.3415 -15.6517 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
3 4 1 0
4 5 1 0
2 6 1 0
2 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
6 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
5 15 1 0
5 16 1 0
16 17 1 0
15 18 1 0
10 19 1 0
10 20 1 0
20 21 1 0
17 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 17 1 0
18 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 18 1 0
21 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 21 1 0
19 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 37 1 0
29 43 1 0
24 44 1 0
40 45 1 0
34 46 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 634.81Molecular Weight (Monoisotopic): 634.3659AlogP: 7.77#Rotatable Bonds: 20Polar Surface Area: 35.74Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.45CX LogP: 7.60CX LogD: 2.24Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.08Np Likeness Score: -0.52
References 1. Jagu E, Pomel S, Diez-Martinez A, Rascol E, Pethe S, Loiseau PM, Labruère R.. (2018) Synthesis and antikinetoplastid evaluation of bis(benzyl)spermidine derivatives., 150 [PMID:29567458 ] [10.1016/j.ejmech.2018.02.087 ]