The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((1S,4S)-5-acryloyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-(4-phenoxyphenoxy)nicotinamide ID: ALA4242598
PubChem CID: 122513214
Max Phase: Preclinical
Molecular Formula: C26H24N4O4
Molecular Weight: 456.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)N1C[C@@H]2C[C@H]1CN2c1ccc(C(N)=O)c(Oc2ccc(Oc3ccccc3)cc2)n1
Standard InChI: InChI=1S/C26H24N4O4/c1-2-24(31)30-16-17-14-18(30)15-29(17)23-13-12-22(25(27)32)26(28-23)34-21-10-8-20(9-11-21)33-19-6-4-3-5-7-19/h2-13,17-18H,1,14-16H2,(H2,27,32)/t17-,18-/m0/s1
Standard InChI Key: FVEYIFISRORTDD-ROUUACIJSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
1.8600 -23.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8588 -23.8783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5669 -24.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2765 -23.8779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2737 -23.0552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5651 -22.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5667 -25.1045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2743 -25.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2699 -26.3287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9767 -26.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6855 -26.3289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6831 -25.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9757 -25.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3937 -26.7367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1009 -26.3273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8048 -26.7369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5116 -26.3282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5112 -25.5102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7980 -25.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0942 -25.5135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8037 -27.5541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0955 -27.9617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5109 -27.9637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7943 -24.2853 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5017 -23.8759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4999 -23.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7921 -22.6531 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0845 -23.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0846 -23.8835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7914 -21.8359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4988 -21.4267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0834 -21.4279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0827 -20.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6572 -23.7151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0770 -24.4497 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.2911 -22.8483 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
16 21 1 0
21 22 2 0
21 23 1 0
19 24 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
27 30 1 0
30 31 2 0
30 32 1 0
32 33 2 0
28 34 1 0
25 34 1 0
25 35 1 6
28 36 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.50Molecular Weight (Monoisotopic): 456.1798AlogP: 3.74#Rotatable Bonds: 7Polar Surface Area: 97.99Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.25CX Basic pKa: 2.99CX LogP: 3.74CX LogD: 3.74Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.54Np Likeness Score: -0.46
References 1. Qiu H, Liu-Bujalski L, Caldwell RD, Follis AV, Gardberg A, Goutopoulos A, Grenningloh R, Head J, Johnson T, Jones R, Mochalkin I, Morandi F, Neagu C, Sherer B.. (2018) Discovery of potent, highly selective covalent irreversible BTK inhibitors from a fragment hit., 28 (17): [PMID:30122225 ] [10.1016/j.bmcl.2018.07.008 ]